|
|
| | O-Desmethyl Gefitinib Basic information |
| | O-Desmethyl Gefitinib Chemical Properties |
| Melting point | 117-120C | | Boiling point | 606.402±55.00 °C(Press: 760.00 Torr)(predicted) | | density | 1.386±0.06 g/cm3(Temp: 25 °C; Press: 760 Torr)(predicted) | | storage temp. | -20°C Freezer | | solubility | DMSO (Slightly), Methanol (Slightly) | | form | Solid | | pka | 7.562±0.40(predicted) | | color | Yellow | | biological source | synthetic | | Stability: | Hygroscopic | | InChI | 1S/C21H22ClFN4O3/c22-16-10-14(2-3-17(16)23)26-21-15-11-20(19(28)12-18(15)24-13-25-21)30-7-1-4-27-5-8-29-9-6-27/h2-3,10-13,28H,1,4-9H2,(H,24,25,26) | | InChIKey | IFMMYZUUCFPEHR-UHFFFAOYSA-N | | SMILES | Fc1c(cc(cc1)Nc2ncnc3c2cc(c(c3)O)OCCCN4CCOCC4)Cl |
| Safety Statements | 24/25 | | WGK Germany | WGK 3 | | HS Code | 29349990 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | O-Desmethyl Gefitinib Usage And Synthesis |
| Chemical Properties | Yellow Solid | | Uses | O-Desmethyl Gefitinib-d8 is the isotope labelled analog of O-Desmethyl Gefitinib (D291680); a major metabolite of Gefitinib (G304000) which is an antineoplastic. | | Definition | ChEBI: O-desmethyl Gefitinib is a member of quinazolines. | | Biological Activity | O-Desmethyl gefitinib is generated by the removal of a methyl group from gefitinib during the bodyμs metabolic processing of this compound within the body. |
| | O-Desmethyl Gefitinib Preparation Products And Raw materials |
|