| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
|
| | Perfluorotetradecanoic acid Basic information |
| Product Name: | Perfluorotetradecanoic acid | | Synonyms: | PERFLUOROMYRISTIC ACID;heptacosafluoro-tetradecanoicaci;Perfluorotetradecanoic acid 97%;Perfluorotetradecanoicacid97%;2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14,14-Heptacosafluorotetradecanoic acid;Perfluorotetradecanoic acid,95%;2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14,14-Hep;Perfluorotetradecanoic acid ,96% | | CAS: | 376-06-7 | | MF: | C14HF27O2 | | MW: | 714.11 | | EINECS: | 206-803-4 | | Product Categories: | C13 to C42+;Carbonyl Compounds;Carboxylic Acids;Building Blocks;C13 to C42+;Carbonyl Compounds;Carboxylic Acids;Chemical Synthesis;Fluorinated Building Blocks;F-Tagged;Organic Building Blocks;Organic Fluorinated Building Blocks | | Mol File: | 376-06-7.mol |  |
| | Perfluorotetradecanoic acid Chemical Properties |
| Melting point | 130-135 °C(lit.) | | Boiling point | 270 °C740 mm Hg(lit.) | | density | 0.89 | | Fp | 192°C/60mm | | storage temp. | -20°C Freezer | | solubility | Chloroform (Slightly, Heated, Sonicated), Methanol (Slightly, Sonicated) | | pka | 0.52±0.10(Predicted) | | form | solid | | color | white | | Water Solubility | It is insoluble in water. | | BRN | 1811438 | | Henry's Law Constant | 1.6×10-3 mol/(m3Pa) at 25℃, Plassmann et al. (2011) | | InChI | 1S/C14HF27O2/c15-2(16,1(42)43)3(17,18)4(19,20)5(21,22)6(23,24)7(25,26)8(27,28)9(29,30)10(31,32)11(33,34)12(35,36)13(37,38)14(39,40)41/h(H,42,43) | | InChIKey | RUDINRUXCKIXAJ-UHFFFAOYSA-N | | SMILES | OC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F | | CAS DataBase Reference | 376-06-7(CAS DataBase Reference) | | EPA Substance Registry System | Perfluorotetradecanoic acid (376-06-7) |
| Hazard Codes | C | | Risk Statements | 34 | | Safety Statements | 26-36/37/39-45-24/25 | | RIDADR | 3261 | | WGK Germany | 3 | | Hazard Note | Corrosive | | TSCA | TSCA listed | | HazardClass | 8 | | PackingGroup | II | | HS Code | 29159000 | | Storage Class | 6.1C - Combustible acute toxic Cat.3
toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 4 Inhalation
Acute Tox. 4 Oral
Carc. 2
Eye Dam. 1
Lact.
Repr. 1B
STOT RE 1 |
| | Perfluorotetradecanoic acid Usage And Synthesis |
| Chemical Properties | off-white crystalline powder | | Uses | Fluorinating agent | | Uses | Perfluorotetradecanoic acid is used for GC (Gas Chromatography) and LC (Liquid Chromatography) analysis. | | General Description | Perfluorotetradecanoic acid belongs to the class of perfluorinated compounds, which are found to be persistent in the environment with bioaccumulative potential. It is used in various commercial applications, including firefighting foams, detergents, insecticides, paper, food containers, as well as to produce photographic films and manufacture fat- and wate-resistant fabrics, etc. |
| | Perfluorotetradecanoic acid Preparation Products And Raw materials |
|