|
|
| | NSC44969 Basic information |
| Product Name: | NSC44969 | | Synonyms: | NSC44969;4-Chloro-2-phenylaniline;5-chloro-biphenyl-2-ylamine;[1,1'-Biphenyl]-2-amine, 5-chloro-;5-Chloro-[1,1''-biphenyl]-2-amine;5-chloro-1，1'-biphenyli-2-amine;5-Chloro-[1,1'-biphenyl]-2-amine | | CAS: | 73006-78-7 | | MF: | C12H10ClN | | MW: | 203.67 | | EINECS: | | | Product Categories: | | | Mol File: | 73006-78-7.mol |  |
| | NSC44969 Chemical Properties |
| Melting point | 54 °C | | Boiling point | 339.8±22.0 °C(Predicted) | | density | 1.205±0.06 g/cm3(Predicted) | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | pka | 3.18±0.10(Predicted) | | Appearance | Off-white to gray Solid | | InChI | InChI=1S/C12H10ClN/c13-10-6-7-12(14)11(8-10)9-4-2-1-3-5-9/h1-8H,14H2 | | InChIKey | HTPGFCKKCPBMTH-UHFFFAOYSA-N | | SMILES | C1(C2=CC=CC=C2)=CC(Cl)=CC=C1N |
| | NSC44969 Usage And Synthesis |
| | NSC44969 Preparation Products And Raw materials |
|