| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
|
| | N-[(3-fluorophenyl)methyl]ethanamine Basic information |
| | N-[(3-fluorophenyl)methyl]ethanamine Chemical Properties |
| Boiling point | 190.7±15.0 °C(Predicted) | | density | 1.009±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C(protect from light) | | pka | 9.41±0.10(Predicted) | | Appearance | Colorless to light yellow Liquid | | InChI | InChI=1S/C9H12FN/c1-2-11-7-8-4-3-5-9(10)6-8/h3-6,11H,2,7H2,1H3 | | InChIKey | QAPAPLIQQTVEJZ-UHFFFAOYSA-N | | SMILES | C1(CNCC)=CC=CC(F)=C1 | | CAS DataBase Reference | 90389-85-8 |
| | N-[(3-fluorophenyl)methyl]ethanamine Usage And Synthesis |
| | N-[(3-fluorophenyl)methyl]ethanamine Preparation Products And Raw materials |
|