| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
- ETHYL 3-FUROATE
-
- $1.00
-
2019-07-06
- CAS:614-98-2
- Min. Order: 1KG
- Purity: 97%
- Supply Ability: 200KG
|
| | Ethyl 3-furancarboxylate Basic information |
| | Ethyl 3-furancarboxylate Chemical Properties |
| Boiling point | 93-95 °C35 mm Hg(lit.) | | density | 1.038 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.46(lit.) | | Fp | 139 °F | | storage temp. | 2-8°C | | solubility | Chloroform (Sparingly), Ethyl Acetate (Slightly), Methanol (Slightly) | | form | clear liquid | | color | Colorless to Light orange to Yellow | | InChI | InChI=1S/C7H8O3/c1-2-10-7(8)6-3-4-9-5-6/h3-5H,2H2,1H3 | | InChIKey | LOFDXZJSDVCYAS-UHFFFAOYSA-N | | SMILES | O1C=CC(C(OCC)=O)=C1 | | LogP | 1.780 | | CAS DataBase Reference | 614-98-2(CAS DataBase Reference) |
| Hazard Codes | Xi,H226 | | Safety Statements | 24/25 | | RIDADR | UN 3272 3/PG 3 | | WGK Germany | 3 | | Hazard Note | Irritant/Keep Cold | | HazardClass | 3.2 | | PackingGroup | III | | HS Code | 29321900 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Flam. Liq. 3 |
| | Ethyl 3-furancarboxylate Usage And Synthesis |
| Chemical Properties | clear slightly yellow to yellow liquid | | Uses | Ethyl 3-furoate was used as starting reagent for the synthesis of ethyl 2,3-bis(trifluoromethyl)-7-oxabicyclo[2,2,1]hepta-2,5-diene-5-carboxylate and 4-(1-hydroxy-1-methyl-ethyl)-furan-2-sulfonamide. | | Definition | ChEBI: Ethyl 3-furoate is a carboxylic ester. It is functionally related to a 2-furoic acid. | | General Description | Ethyl 3-furoate undergoes regioselective palladium(0)-catalyzed arylation reaction with aryl bromides. |
| | Ethyl 3-furancarboxylate Preparation Products And Raw materials |
|