| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 3,4,5-Trichlorothiophene-2-carboxylic acid Basic information |
| Product Name: | 3,4,5-Trichlorothiophene-2-carboxylic acid | | Synonyms: | 3,4,5-TRICHLOROTHIOPHENE-2-CARBOXYLIC ACID, 98+%;2-Thiophenecarboxylic acid, 3,4,5-trichloro-;TRICHLOROTHIOPHENE-2-CARBOXYLIC ACID;3,4,5-TRICHLORO-2-THIOPHENECARBOXYLIC ACID;3,4,5-Trichlorothiophene-2-carboxylic acid | | CAS: | 26020-48-4 | | MF: | C5HCl3O2S | | MW: | 231.48 | | EINECS: | | | Product Categories: | | | Mol File: | 26020-48-4.mol |  |
| | 3,4,5-Trichlorothiophene-2-carboxylic acid Chemical Properties |
| Melting point | 226-228°C | | Boiling point | 335.6±37.0 °C(Predicted) | | density | 1.818±0.06 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C | | pka | 2.89±0.10(Predicted) | | Appearance | Light yellow to light brown Solid | | Water Solubility | Insoluble in water. | | BRN | 155175 | | InChI | InChI=1S/C5HCl3O2S/c6-1-2(7)4(8)11-3(1)5(9)10/h(H,9,10) | | InChIKey | FVFYTPFJDMYLJS-UHFFFAOYSA-N | | SMILES | C1(C(O)=O)SC(Cl)=C(Cl)C=1Cl | | CAS DataBase Reference | 26020-48-4 |
| Provider | Language |
|
ALFA
| English |
| | 3,4,5-Trichlorothiophene-2-carboxylic acid Usage And Synthesis |
| Uses | 3,4,5-Trichloro-2-thiophenecarboxylic Acid is a useful research chemical compound used as a reactant in the stereoselective synthesis of alkenyl or allylic arenes. |
| | 3,4,5-Trichlorothiophene-2-carboxylic acid Preparation Products And Raw materials |
|