| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | Ethyl trimethylsilyl malonate Basic information |
| | Ethyl trimethylsilyl malonate Chemical Properties |
| Boiling point | 75 °C/0.5 mmHg (lit.) | | density | 1 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.416(lit.) | | Fp | 130 °F | | storage temp. | 2-8°C | | form | liquid | | BRN | 3082383 | | InChI | 1S/C8H16O4Si/c1-5-11-7(9)6-8(10)12-13(2,3)4/h5-6H2,1-4H3 | | InChIKey | PVXMKQLVICGFSI-UHFFFAOYSA-N | | SMILES | CCOC(=O)CC(=O)O[Si](C)(C)C |
| Risk Statements | 10 | | Safety Statements | 23-24/25 | | RIDADR | UN 3272 3/PG 3 | | WGK Germany | 3 | | F | 10-21 | | HazardClass | 3.2 | | PackingGroup | III | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Flam. Liq. 3 |
| | Ethyl trimethylsilyl malonate Usage And Synthesis |
| Preparation | Ethyl trimethylsilyl malonate is commercially available, or it may be easily prepared from the potassium salt of Ethyl Malonate. Methyl trimethylsilyl malonate has been prepared from tbutyl methyl malonate by treatment with Trimethylsilyl Trifluoromethanesulfonate, or from Meldrum's acid (2,2-Dimethyl-1,3-dioxane-4,6-dione) and methyl trimethylsilyl ether. The preparation and use of tbutyl trimethylsilyl malonate has been reported, although it has not been isolated and characterized. | | General Description | Ethyl trimethylsilyl malonate is an ester. | | storage | The ethyl derivative is reported to be moisture sensitive. |
| | Ethyl trimethylsilyl malonate Preparation Products And Raw materials |
|