| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
|
| | Ethyl4-Methyl-2-(thiophen-2-yl)thiazole-5-carboxylate Basic information |
| Product Name: | Ethyl4-Methyl-2-(thiophen-2-yl)thiazole-5-carboxylate | | Synonyms: | ETHYL 4-METHYL-2-(2-THIENYL)-1,3-THIAZOLE-5-CARBOXYLATE;ethyl 4-methyl-2-(2-thienyl)-thiazole-5 Carboxylate;4-methyl-2-(2-thienyl)-5-Thiazolecarboxylic acid ethyl ester;5-Thiazolecarboxylic acid, 4-methyl-2-(2-thienyl)-, ethyl ester;ethyl 4-methyl-2-thiophen-2-yl-1,3-thiazole-5-carboxylate;4-Methyl-2-(2-thienyl)-1,3-thiazole-5-carboxylic acid ethyl ester | | CAS: | 56421-62-6 | | MF: | C11H11NO2S2 | | MW: | 253.34 | | EINECS: | | | Product Categories: | | | Mol File: | 56421-62-6.mol |  |
| | Ethyl4-Methyl-2-(thiophen-2-yl)thiazole-5-carboxylate Chemical Properties |
| Melting point | 66-68°C | | Boiling point | 380.9±50.0 °C(Predicted) | | density | 1.282±0.06 g/cm3(Predicted) | | solubility | DMF: 10 mg/ml; DMF:PBS (pH 7.2) (1:9): 0.1 mg/ml; DMSO: 5 mg/ml; Ethanol: 1 mg/ml | | form | A crystalline solid | | pka | 1.26±0.10(Predicted) | | InChI | 1S/C11H11NO2S2/c1-3-14-11(13)9-7(2)12-10(16-9)8-5-4-6-15-8/h4-6H,3H2,1-2H3 | | InChIKey | NRTAQEAHFFIBFX-UHFFFAOYSA-N | | SMILES | CCOC(=O)c1sc(nc1C)-c2cccs2 | | CAS DataBase Reference | 56421-62-6 |
| Hazard Codes | Xi | | Risk Statements | 41 | | Safety Statements | 26-39 | | WGK Germany | WGK 3 | | HazardClass | IRRITANT | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Dam. 1 |
| | Ethyl4-Methyl-2-(thiophen-2-yl)thiazole-5-carboxylate Usage And Synthesis |
| Description | ethyl 4-methyl-2-(2-thienyl)-thiazole-5 Carboxylate is a synthetic intermediate useful for pharmaceutical synthesis. | | Uses | Ethyl4-Methyl-2-(thiophen-2-yl)thiazole-5-carboxylate is a synthetic intermediate useful for pharmaceutical synthesis. |
| | Ethyl4-Methyl-2-(thiophen-2-yl)thiazole-5-carboxylate Preparation Products And Raw materials |
|