|
|
| | 2-methacryloyloxyethyl phosphorylcholine Basic information |
| Product Name: | 2-methacryloyloxyethyl phosphorylcholine | | Synonyms: | 2-methacryloyloxyethyl phosphorylcholine;Creatinol O-phosphate Magnesium;Phosphoric Acid 2-(Methacryloyloxy)ethyl 2-(Trimethylammonio)ethyl Ester;[2-[[2-(Methacryloyloxy)ethoxy]phosphonyloxy]ethyl]trimethylaminium;Methacrylic acid 2-[[[2-(trimethylaminio)ethoxy]phosphonyl]oxy]ethyl ester;O-[[2-(Methacryloyloxy)ethoxy]phosphonyl]choline;O-[[2-[(2-Methylpropenoyl)oxy]ethoxy]phosphonyl]choline;Phosphoric acid hydrogen 2-(trimethylaminio)ethyl 2-(methacryloyloxy)ethyl ester | | CAS: | 67881-98-5 | | MF: | C11H22NO6P | | MW: | 295.27 | | EINECS: | 417-560-0 | | Product Categories: | Ammonium Polyhalides, etc. (Quaternary);Quaternary Ammonium Compounds;MPC | | Mol File: | 67881-98-5.mol |  |
| | 2-methacryloyloxyethyl phosphorylcholine Chemical Properties |
| Melting point | 143-148°C | | density | 1.22-1.41 at 21.5-22.4℃ | | vapor pressure | 0-0Pa at 25℃ | | storage temp. | 2-8°C | | form | Powder | | color | White to Almost white | | Water Solubility | 83-86vol% at 20℃ and pH5.9-6.8[vol%] | | InChI | InChI=1S/C11H22NO6P/c1-10(2)11(13)16-8-9-18-19(14,15)17-7-6-12(3,4)5/h1,6-9H2,2-5H3 | | InChIKey | ZSZRUEAFVQITHH-UHFFFAOYSA-N | | SMILES | O(CC[N+](C)(C)C)P([O-])(=O)OCCOC(=O)C(=C)C | | LogP | -1.76 at 21℃ | | Surface tension | 71.9-72.01mN/m at 1-1.09g/L and 20.1-22℃ | | CAS DataBase Reference | 67881-98-5(CAS DataBase Reference) |
| Safety Statements | 24/25 | | WGK Germany | 1 | | HS Code | 29239000 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Skin Sens. 1 |
| | 2-methacryloyloxyethyl phosphorylcholine Usage And Synthesis |
| Chemical Properties | White solid | | Uses | MPC block copolymers with styrene are biocompatible in nature. | | Application | Among biocompatible polymers, a polymer family containing 2-methacryloyloxyethyl phosphorylcholine (MPC) has attracted attention for fundamental studies and applications. MPC polymers are synthetic phospholipid polymers with zwitterionic phosphorylcholine (PC) head groups, which can form cell-membrane-like structures on various material surfaces. This special surface structure has a unique capacity to prevent nonspecific protein adsorption (NPA) and thus biofouling by the adsorption of biomolecules, cells, and other biological entities. This property is helpful in applications involving biological entities (e.g., proteins, other biomolecules, cells), biological samples (e.g., tears, saliva), contact with plasma and whole blood, and implantation in the body or other biological environments[1]. | | General Description |
2-methacryloyloxyethyl phosphorylcholine(MPC), containing a phosphorylcholine group in the side chain is a most suitable monomer to mimic the phospholipid polar groups contained with cell membranes. MPC block copolymers are biocompatible in nature; it shows desirable interaction with living tissues. It is hydroscopic in nature.
| | in vivo | 2-Methacryloyloxyethyl phosphorylcholine polymer (PMB-coated suture; s.c.) suppresses bacterial attachment and biofilm formation in C57BL/6J mice[4].
| | References |
[1] Seetasang, Sasikarn and Yan Xu. “Recent progress and perspectives in applications of 2-methacryloyloxyethyl phosphorylcholine polymers in biodevices at small scales.” Journal of Materials Chemistry B 14 (2022): 2323–2337.
|
| | 2-methacryloyloxyethyl phosphorylcholine Preparation Products And Raw materials |
|