|
|
| | 5-(beta-hydroxyethyl)-4-methylthiazole-2-carboxylic acid Basic information |
| | 5-(beta-hydroxyethyl)-4-methylthiazole-2-carboxylic acid Chemical Properties |
| InChI | InChI=1S/C7H9NO3S/c1-4-5(2-3-9)12-6(8-4)7(10)11/h9H,2-3H2,1H3,(H,10,11) | | InChIKey | LNYKIGXWFDMPNZ-UHFFFAOYSA-N | | SMILES | S1C(CCO)=C(C)N=C1C(O)=O |
| | 5-(beta-hydroxyethyl)-4-methylthiazole-2-carboxylic acid Usage And Synthesis |
| Uses | 5-(beta-hydroxyethyl)-4-methylthiazole-2-carboxylic acid (4-Methyl-5-Hydroxyethylthiazole Phosphate) is a small molecule belonging to the 4,5-disubstituted thiazole class of organic compounds. These compounds contain a substituted thiazole ring only in the 4th and 5th positions. The compound is involved in thiamine metabolism. It condenses 4-methyl-5-(beta-hydroxyethyl)thiazole monophosphate (THZ-P) and 2-methyl-4-amino-5-hydroxymethyl pyrimidine pyrophosphate (HMP-PP) to form thiamine monophosphate (TMP). |
| | 5-(beta-hydroxyethyl)-4-methylthiazole-2-carboxylic acid Preparation Products And Raw materials |
|