| Company Name: |
Shanghai Kewel Chemical Co., Ltd.
|
| Tel: |
021-64609169 18901607656 |
| Email: |
greensnown@163.com |
| Products Intro: |
Product Name:Benzopyrene Impurity 2 CAS:55097-80-8 Purity:95+ HPLC; Package:10mg;25mg;50mg;100mg
|
| Company Name: |
Jiangsu Aikon Biopharmaceutical R&D co.,Ltd.
|
| Tel: |
025-66028182 17714375163 |
| Email: |
yftan@aikonchem.com |
| Products Intro: |
Product Name:7,8,8a,9a-Tetrahydrobenzo[1,12]tetrapheno[10,11-b]oxirene-7,8-diol CAS:55097-80-8 Purity:95+% Package:1g;5g;10g
|
|
| | 7,8-Dihydro-7,8-dihydroxybenzo(a)pyrene 9,10-oxide Basic information |
| Product Name: | 7,8-Dihydro-7,8-dihydroxybenzo(a)pyrene 9,10-oxide | | Synonyms: | 7,8-Dihydro-7,8-dihydroxybenzo(a)pyrene 9,10-oxide;7,8,9,10-Tetrahydro-7,8-dihydroxybenzo[a]pyrene 9,10-epoxide;Benzopyrene Related Compound 10;Benzo[10,11]chryseno[3,4-b]oxirene-7,8-diol, 7,8,8a,9a-tetrahydro- | | CAS: | 55097-80-8 | | MF: | C20H14O3 | | MW: | 302.32 | | EINECS: | | | Product Categories: | | | Mol File: | 55097-80-8.mol |  |
| | 7,8-Dihydro-7,8-dihydroxybenzo(a)pyrene 9,10-oxide Chemical Properties |
| Boiling point | 594.2±50.0 °C(Predicted) | | density | 1.569 | | pka | 13.50±0.40(Predicted) | | InChI | InChI=1S/C20H14O3/c21-17-13-8-11-5-4-9-2-1-3-10-6-7-12(15(11)14(9)10)16(13)19-20(23-19)18(17)22/h1-8,17-22H | | InChIKey | DQEPMTIXHXSFOR-UHFFFAOYSA-N | | SMILES | O1C2C3=C(C(O)C(O)C12)C=C1C=CC2=C4C1=C3C=CC4=CC=C2 |
| | 7,8-Dihydro-7,8-dihydroxybenzo(a)pyrene 9,10-oxide Usage And Synthesis |
| Definition | ChEBI: Benzo[a]pyrene diol epoxide I is an epoxide. It has a role as an intercalator. It derives from a hydride of a benzo[a]pyrene. |
| | 7,8-Dihydro-7,8-dihydroxybenzo(a)pyrene 9,10-oxide Preparation Products And Raw materials |
|