BENZO[A]PYRENE-D12 manufacturers
- BENZO[A]PYRENE-D12
-
- $1.00
-
2020-01-10
- CAS:63466-71-7
- Min. Order: 1g
- Purity: 99.0%
- Supply Ability: 100kg
|
| | BENZO[A]PYRENE-D12 Basic information |
| Product Name: | BENZO[A]PYRENE-D12 | | Synonyms: | BENZO(A)PYRENE-D12, 98 ATOM % D;3,4-benzopyrene-d12;Benzo[a]pyrene-d12,3,4-Benzopyrene-d12;Benzo[a]pyrene-1,2,3,4,5,6,7,8,9,10,11,12-d12;Perdeuterated benzo[a]pyrene;Benzo[a]pyrene-1,2,3,4,5,6,7,8,9,10,11,12-d12;Benzo[a]pyrene-d12;Benzo[a]pyrene (D12, 97%) | | CAS: | 63466-71-7 | | MF: | C20D12 | | MW: | 264.38 | | EINECS: | | | Product Categories: | | | Mol File: | 63466-71-7.mol | ![BENZO[A]PYRENE-D12 Structure](CAS/GIF/63466-71-7.gif) |
| | BENZO[A]PYRENE-D12 Chemical Properties |
| Melting point | 177-180 °C(lit.) | | Boiling point | 495 °C(lit.) | | storage temp. | 0-6°C | | solubility | Chloroform (Slightly), Ethyl Acetate (Slightly), Hexanes (Slightly) | | form | solid | | Major Application | electronics | | InChI | 1S/C20H12/c1-2-7-17-15(4-1)12-16-9-8-13-5-3-6-14-10-11-18(17)20(16)19(13)14/h1-12H/i1D,2D,3D,4D,5D,6D,7D,8D,9D,10D,11D,12D | | InChIKey | FMMWHPNWAFZXNH-AQZSQYOVSA-N | | SMILES | [2H]c1c([2H])c([2H])c2c(c1[2H])c([2H])c3c([2H])c([2H])c4c([2H])c([2H])c([2H])c5c([2H])c([2H])c2c3c45 | | EPA Substance Registry System | Benzo[a]pyrene-d12 (63466-71-7) |
| Hazard Codes | T,N | | Risk Statements | 45-46-60-61-43-50/53 | | Safety Statements | 53-45-60-61 | | RIDADR | UN 3077 9/PG 3 | | WGK Germany | 3 | | HS Code | 28459000 | | Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Aquatic Acute 1 Aquatic Chronic 1 Carc. 1B Muta. 1B Repr. 1B Skin Sens. 1 |
| | BENZO[A]PYRENE-D12 Usage And Synthesis |
| Uses | Benzo[a]pyrene-d12 can be used as a stable isotope internal standard for the quantification of benzo(a)pyrene content in specific food samples using gas chromatography/mass spectrometry. | | General Description | Benzo[a]pyrene-d12 is an isotope-labeled analog of the polycyclic aromatic hydrocarbon benzo[a]pyrene, wherein all the carbon attached protons (C-H) are replaced by deuterium atoms. |
| | BENZO[A]PYRENE-D12 Preparation Products And Raw materials |
|