|
|
| | Diisobutyldimethoxysilane Basic information |
| Product Name: | Diisobutyldimethoxysilane | | Synonyms: | DIISOBUTYLDIMETHOXYSILANE;dimethoxybis(2-methylpropyl)-silan;dimethoxybis(2-methylpropyl)-Silane;Silane, dimethoxybis(2-methylpropyl)-;Diisobutyldimethoxysilan;Diisobutyl DiMethoxy Silane (DIBMS);DIISOBUTYLDIMETHOXYSILANE FOR SYNTHESIS;Diisobutyldimethoxysilane > | | CAS: | 17980-32-4 | | MF: | C10H24O2Si | | MW: | 204.38 | | EINECS: | 605-870-0 | | Product Categories: | | | Mol File: | 17980-32-4.mol |  |
| | Diisobutyldimethoxysilane Chemical Properties |
| Melting point | <-78°C | | Boiling point | 120 °C | | density | 0.87 | | vapor pressure | 0.75 hPa ( 25 °C) | | refractive index | 1.4235-1.4255 | | Fp | 76°C | | storage temp. | Store below +30°C. | | form | clear liquid | | color | Colorless to Almost colorless | | Specific Gravity | 0.87 | | Hydrolytic Sensitivity | 7: reacts slowly with moisture/water | | Sensitive | Moisture Sensitive | | BRN | 2636371 | | InChI | 1S/C10H24O2Si/c1-9(2)7-13(11-5,12-6)8-10(3)4/h9-10H,7-8H2,1-6H3 | | InChIKey | NHYFIJRXGOQNFS-UHFFFAOYSA-N | | SMILES | [Si](OC)(OC)(CC(C)C)CC(C)C | | CAS DataBase Reference | 17980-32-4(CAS DataBase Reference) | | EPA Substance Registry System | Silane, dimethoxybis(2-methylpropyl)- (17980-32-4) |
| Risk Statements | 51/53-36/38 | | Safety Statements | 36/37/39-45-26/36 | | RIDADR | 3082 | | WGK Germany | WGK 2 | | Autoignition Temperature | 255°C | | TSCA | TSCA listed | | HazardClass | 9 | | HS Code | 29319090 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Aquatic Chronic 2 |
| Provider | Language |
|
ALFA
| English |
| | Diisobutyldimethoxysilane Usage And Synthesis |
| Uses | Diisobutyldimethoxysilane is a colorless, transparent liquid used as a catalyst in propylene polymerization.
|
| | Diisobutyldimethoxysilane Preparation Products And Raw materials |
|