|
|
| | N-Nitroso-N-(phosphonoMethyl)glycine Basic information |
| | N-Nitroso-N-(phosphonoMethyl)glycine Chemical Properties |
| Melting point | >119oC (subl.) | | Boiling point | 634.1±65.0 °C(Predicted) | | density | 1.97±0.1 g/cm3(Predicted) | | storage temp. | Hygroscopic, -20°C Freezer, Under Inert Atmosphere | | solubility | Methanol (Slightly), Water (Slightly) | | form | Solid | | pka | 2.00±0.10(Predicted) | | color | White to Off-White | | Stability: | Hygroscopic | | InChI | InChI=1S/C3H7N2O6P/c6-3(7)1-5(4-8)2-12(9,10)11/h1-2H2,(H,6,7)(H2,9,10,11) | | InChIKey | BJYYBQPCMQGLLZ-UHFFFAOYSA-N | | SMILES | C(O)(=O)CN(N=O)CP(O)(O)=O |
| Toxicity | mmo-sat 1 mL/plate MUREAV 48,225,77 |
| | N-Nitroso-N-(phosphonoMethyl)glycine Usage And Synthesis |
| Chemical Properties | Off-White Solid | | Uses | N-Nitroso-N-(phosphonomethyl)glycine is used as herbicide. | | Safety Profile | Mutation data reported. Many Nnitroso compounds are carcinogens. When heated todecomposition it emits very toxic fumes of POx and NOx. |
| | N-Nitroso-N-(phosphonoMethyl)glycine Preparation Products And Raw materials |
|