| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 3-Azabicyclo[3.1.0]hexane-2-carboxylic acid Basic information |
| | 3-Azabicyclo[3.1.0]hexane-2-carboxylic acid Chemical Properties |
| Melting point | 252-256 °C(lit.) | | Boiling point | 280.3±23.0 °C(Predicted) | | density | 1.327±0.06 g/cm3(Predicted) | | pka | 2.38±0.20(Predicted) | | InChI | 1S/C6H9NO2/c8-6(9)5-4-1-3(4)2-7-5/h3-5,7H,1-2H2,(H,8,9)/t3-,4-,5-/m0/s1 | | InChIKey | JBDOTWVUXVXVDR-YUPRTTJUSA-N | | SMILES | [H][C@]12CN[C@H](C(O)=O)[C@@]1([H])C2 | | CAS DataBase Reference | 22255-16-9(CAS DataBase Reference) |
| Hazard Codes | Xi,Xn | | Risk Statements | 36/37/38-22 | | Safety Statements | 26-36 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 29224985 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 3-Azabicyclo[3.1.0]hexane-2-carboxylic acid Usage And Synthesis |
| Uses | Cis-3-azabicyclo[3.1.0]hexane-2-carboxylic acid is used as a reactant in the preparation of azabicyclohexane derivatives as orexin receptor antagonists. |
| | 3-Azabicyclo[3.1.0]hexane-2-carboxylic acid Preparation Products And Raw materials |
|