| Company Name: |
BOC Sciences |
| Tel: |
16314854226 |
| Email: |
info@bocsci.com |
|
| | 6-beta-Hydroxy budesonide Basic information |
| Product Name: | 6-beta-Hydroxy budesonide | | Synonyms: | 6-hydroxybudesonide;(6β,11β,16α)-;6β-Hydroxy 21-Acetyloxy Budesonide-d8;Budesonide 6-beta-Hydroxy Impurity;Pregna-1,4-diene-3,20-dione, 16,17-(butylidenebis(oxy))-6,11,21-trihydroxy-, (6beta,11beta,16alpha)-;6-beta-Hydroxy Budesonide (Mixture of Diastereomers);6β-Hydroxy Budesonide;Triamcinolone Hexacetonide Impurity 8 | | CAS: | 88411-77-2 | | MF: | C25H34O7 | | MW: | 446.53 | | EINECS: | | | Product Categories: | Intermediates & Fine Chemicals;Metabolites;Pharmaceuticals;Steroids;Metabolites & Impurities | | Mol File: | 88411-77-2.mol |  |
| | 6-beta-Hydroxy budesonide Chemical Properties |
| Melting point | 126-128°C | | Boiling point | 641.4±55.0 °C(Predicted) | | density | 1.33±0.1 g/cm3(Predicted) | | storage temp. | -20°C Freezer | | solubility | Dichloromethane, Ether | | pka | 12.87±0.10(Predicted) | | form | Solid | | color | White to Pale Yellow | | Stability: | Hygroscopic | | Major Application | pharmaceutical | | InChIKey | JBVVDXJXIDYDMF-LLYNVSGKSA-N | | SMILES | C1(=O)C=C2[C@](C)(C=C1)[C@]1([H])[C@]([H])([C@@]3([H])[C@@](C[C@@H]1O)(C)[C@@]1(OC(O[C@@]1([H])C3)CCC)C(=O)CO)C[C@H]2O | | CAS DataBase Reference | 88411-77-2 |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Repr. 2 |
| | 6-beta-Hydroxy budesonide Usage And Synthesis |
| Chemical Properties | White to Light Yellow Solid | | Uses | A metabolite of Budesonide, a non-halogenated glucocorticoid related to triamcinolone hexacetonide. Used as an antiinflammatory agent | | Uses | 6-BETA-HYDROXY BUDESONIDE is a metabolite of Budesonide (B689490), a non-halogenated glucocorticoid related to triamcinolone hexacetonide.It is Used as an antiinflammatory agent. | | Uses | Protected 6β-Hydroxy Budesonide-d8 (H830352). A labelled metabolite of Budesonide (B689490). Used as an antiinflammatory agent. | | Definition | ChEBI: 6beta-hydroxybudesonide is a 21-hydroxy steroid. |
| | 6-beta-Hydroxy budesonide Preparation Products And Raw materials |
|