2,4-Pentandedione, 3-(phenylmethyl) manufacturers
|
| | 2,4-Pentandedione, 3-(phenylmethyl) Basic information |
| Product Name: | 2,4-Pentandedione, 3-(phenylmethyl) | | Synonyms: | 2,4-Pentandedione, 3-(phenylmethyl);3-(phenylmethyl)pentane-2,4-dione;3-benzyl-2,4-pentanedione(SALTDATA: FREE);2,4-Pentanedione, 3-(phenylmethyl)-;3-Benzylpentane-2,4-dione | | CAS: | 1134-87-8 | | MF: | C12H14O2 | | MW: | 190.24 | | EINECS: | | | Product Categories: | | | Mol File: | 1134-87-8.mol |  |
| | 2,4-Pentandedione, 3-(phenylmethyl) Chemical Properties |
| Melting point | 203-205 °C | | Boiling point | 150 °C(Press: 3 Torr) | | density | 1.059 g/cm3 | | pka | 10.26±0.46(Predicted) | | form | solid | | InChI | 1S/C12H14O2/c1-9(13)12(10(2)14)8-11-6-4-3-5-7-11/h3-7,12H,8H2,1-2H3 | | InChIKey | WAJQTBOWJRUOOO-UHFFFAOYSA-N | | SMILES | O=C(C)C(CC1=CC=CC=C1)C(C)=O |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | 2,4-Pentandedione, 3-(phenylmethyl) Usage And Synthesis |
| | 2,4-Pentandedione, 3-(phenylmethyl) Preparation Products And Raw materials |
|