| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Wuxi AppTec |
| Tel: |
022-59987777 13552403979 |
| Email: |
jia_guoqiang@wuxiapptec.com |
|
| | 3-Nitro-thiobenzamide Basic information |
| Product Name: | 3-Nitro-thiobenzamide | | Synonyms: | 3-Nitrobenzothioamide;Benzenecarbothioamide, 3-nitro-;3-nitrobenzenecarbothioamide;3-Nitrobenzene-1-carbothioamide;3-Nitro-thiobenzamide | | CAS: | 70102-34-0 | | MF: | C7H6N2O2S | | MW: | 182.2 | | EINECS: | | | Product Categories: | | | Mol File: | 70102-34-0.mol |  |
| | 3-Nitro-thiobenzamide Chemical Properties |
| Melting point | 130-131 °C | | Boiling point | 336.3±44.0 °C(Predicted) | | density | 1.425±0.06 g/cm3(Predicted) | | form | solid | | pka | 12.02±0.29(Predicted) | | InChI | 1S/C7H6N2O2S/c8-7(12)5-2-1-3-6(4-5)9(10)11/h1-4H,(H2,8,12) | | InChIKey | HDQCHDWHHGEXQE-UHFFFAOYSA-N | | SMILES | NC(=S)c1cccc(c1)[N+]([O-])=O | | CAS DataBase Reference | 70102-34-0 |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Sens. 1 |
| | 3-Nitro-thiobenzamide Usage And Synthesis |
| | 3-Nitro-thiobenzamide Preparation Products And Raw materials |
|