| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 3-Fluoro-5-hydroxybenzonitrile Basic information |
| | 3-Fluoro-5-hydroxybenzonitrile Chemical Properties |
| Boiling point | 255.8±25.0 °C(Predicted) | | density | 1.34±0.1 g/cm3(Predicted) | | storage temp. | Inert atmosphere,Room Temperature | | pka | 7.58±0.10(Predicted) | | Appearance | Off-white to light brown Solid | | InChI | InChI=1S/C7H4FNO/c8-6-1-5(4-9)2-7(10)3-6/h1-3,10H | | InChIKey | ATVNHLQIIAOSEM-UHFFFAOYSA-N | | SMILES | C(#N)C1=CC(O)=CC(F)=C1 |
| Hazard Codes | Xn,N | | Risk Statements | 22-41-51/53 | | Safety Statements | 26-39-61 | | RIDADR | UN 3082 9 / PGIII | | HazardClass | 6.1 | | PackingGroup | Ⅲ | | HS Code | 2926907090 |
| | 3-Fluoro-5-hydroxybenzonitrile Usage And Synthesis |
| Chemical Properties | off-white powder | | Uses |
3-Fluoro-5-hydroxybenzonitrile is commonly used as an intermediate in organic synthesis and pharmaceuticals.
|
| | 3-Fluoro-5-hydroxybenzonitrile Preparation Products And Raw materials |
|