| Company Name: |
3B Pharmachem (Wuhan) International Co.,Ltd.
|
| Tel: |
821-50328103-801 18930552037 |
| Email: |
3bsc@sina.com |
| Products Intro: |
Product Name:(R)-(-)-NIRVANOL
CAS:65567-32-0
Purity:99% HPLC Package:1Mg ; 5Mg;10Mg ;100Mg;250Mg ;500Mg ;1g;2.5g ;5g ;10g
|
| Company Name: |
Shanghai Jizhi Biochemical Technology Co. Ltd.
|
| Tel: |
021-4009004166/18616739031 18616739031 |
| Email: |
3007523370@qq.com |
| Products Intro: |
Product Name:(R)-5-Ethyl-5-phenylimidazolidine-2,4-dione
CAS:65567-32-0
Purity:95+% Package:100mg;250mg;1g Remarks:R49870
|
|
| | (R)-(-)-NIRVANOL Basic information |
| Product Name: | (R)-(-)-NIRVANOL | | Synonyms: | (R)-(-)-5-ETHYL-5-PHENYL-2,4-IMIDAZOLIDINEDIONE;(R)-(-)-5-ETHYL-5-PHENYLHYDANTOIN;R-(-)-N-DESMETHYLMEPHENTOIN;(R)-(-)-NIRVANOL;5-ethyl-5-phenyl-4-imidazolidinedion(r)-;l-5-ethyl-5-phenylhydantoin;l-nirvanol;2,4-Imidazolidinedione, 5-ethyl-5-phenyl-, (R)- (9CI) | | CAS: | 65567-32-0 | | MF: | C11H12N2O2 | | MW: | 204.23 | | EINECS: | | | Product Categories: | Various Metabolites and Impurities | | Mol File: | 65567-32-0.mol |  |
| | (R)-(-)-NIRVANOL Chemical Properties |
| Melting point | 236°C | | Boiling point | 342.72°C (rough estimate) | | density | 1.1754 (rough estimate) | | refractive index | 1.5200 (estimate) | | storage temp. | 2-8°C | | solubility | DMF: soluble | | form | Solid | | color | off-white | | InChI | 1S/C11H12N2O2/c1-2-11(8-6-4-3-5-7-8)9(14)12-10(15)13-11/h3-7H,2H2,1H3,(H2,12,13,14,15)/t11-/m1/s1 | | InChIKey | UDTWZFJEMMUFLC-LLVKDONJSA-N | | SMILES | CC[C@@]1(NC(=O)NC1=O)c2ccccc2 |
| Hazard Codes | Xn | | Risk Statements | 22-36/37/38 | | Safety Statements | 26 | | WGK Germany | 2 | | RTECS | MU2452000 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral
Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | (R)-(-)-NIRVANOL Usage And Synthesis |
| Chemical Properties | Off-White Solid | | Biological Activity | CYP2B6 metabolite of (S)-(+)-mephenytoin; anticonvulsant; hypnotic. |
| | (R)-(-)-NIRVANOL Preparation Products And Raw materials |
|