| Company Name: |
BOC Sciences |
| Tel: |
16314854226; +8616314854226 |
| Email: |
inquiry@bocsci.com |
|
| | (R)-(-)-Nirvanol Basic information |
| Product Name: | (R)-(-)-Nirvanol | | Synonyms: | (R)-(-)-5-ETHYL-5-PHENYL-2,4-IMIDAZOLIDINEDIONE;(R)-(-)-5-ETHYL-5-PHENYLHYDANTOIN;R-(-)-N-DESMETHYLMEPHENTOIN;5-ethyl-5-phenyl-4-imidazolidinedion(r)-;l-5-ethyl-5-phenylhydantoin;l-nirvanol;2,4-Imidazolidinedione, 5-ethyl-5-phenyl-, (R)- (9CI);(R)-(-)-5-Ethyl-5-phenyl-2,4-imidazolidinedione, (R)-(-)-5-Ethyl-5-phenylhydantoin | | CAS: | 65567-32-0 | | MF: | C11H12N2O2 | | MW: | 204.23 | | EINECS: | | | Product Categories: | Various Metabolites and Impurities | | Mol File: | 65567-32-0.mol |  |
| | (R)-(-)-Nirvanol Chemical Properties |
| Melting point | 236°C | | Boiling point | 342.72°C (rough estimate) | | density | 1.1754 (rough estimate) | | refractive index | 1.5200 (estimate) | | storage temp. | 2-8°C | | solubility | DMF: soluble | | form | Solid | | color | off-white | | InChI | 1S/C11H12N2O2/c1-2-11(8-6-4-3-5-7-8)9(14)12-10(15)13-11/h3-7H,2H2,1H3,(H2,12,13,14,15)/t11-/m1/s1 | | InChIKey | UDTWZFJEMMUFLC-LLVKDONJSA-N | | SMILES | CC[C@@]1(NC(=O)NC1=O)c2ccccc2 |
| Hazard Codes | Xn | | Risk Statements | 22-36/37/38 | | Safety Statements | 26 | | WGK Germany | 2 | | RTECS | MU2452000 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral
Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | (R)-(-)-Nirvanol Usage And Synthesis |
| Chemical Properties | Off-White Solid | | Biological Activity | CYP2B6 metabolite of (S)-(+)-mephenytoin; anticonvulsant; hypnotic. |
| | (R)-(-)-Nirvanol Preparation Products And Raw materials |
|