3-(5-Nitro-2-furyl)acrylic acid manufacturers
|
| | 3-(5-Nitro-2-furyl)acrylic acid Basic information |
| Product Name: | 3-(5-Nitro-2-furyl)acrylic acid | | Synonyms: | RARECHEM BK HD 0012;3-(5-nitro-2-furanyl)-2-propenoicaci;3-(5-Nitro-2-furanyl)-2-propenoicacid;5-nfa;5-nitro-2-furanacrylicaci;5-nitro-2-furylacrylicacid;5-nitro-2-furylakrylovakyselina;5-Nitrofuranacrylicacid | | CAS: | 6281-23-8 | | MF: | C7H5NO5 | | MW: | 183.12 | | EINECS: | 228-488-2 | | Product Categories: | Furans | | Mol File: | 6281-23-8.mol |  |
| | 3-(5-Nitro-2-furyl)acrylic acid Chemical Properties |
| Melting point | 238-240°C | | Boiling point | 316.77°C (rough estimate) | | density | 1.6074 (rough estimate) | | refractive index | 1.6280 (estimate) | | pka | 3.95±0.10(Predicted) | | form | powder to crystal | | color | Light yellow to Yellow to Orange | | InChI | 1S/C7H5NO5/c9-7(10)4-2-5-1-3-6(13-5)8(11)12/h1-4H,(H,9,10)/b4-2+ | | InChIKey | LWOWNIPZHGWKNR-DUXPYHPUSA-N | | SMILES | OC(=O)\C=C\c1ccc(o1)[N+]([O-])=O | | CAS DataBase Reference | 6281-23-8(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36-43 | | Safety Statements | 26-36/37 | | WGK Germany | 3 | | RTECS | LT8566000 | | HS Code | 2932.19.5100 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 |
| | 3-(5-Nitro-2-furyl)acrylic acid Usage And Synthesis |
| Chemical Properties | Light yellow crystal or powder. Melting point 236℃. | | Uses | 3-(5-Nitro-2-furyl)acrylic acid is an intermediates of furan propylamine. | | Synthesis | It is condensed with furan formaldehyde and acetaldehyde to generate furan acrolein, which is then oxidized to furan acrylic acid, and then nitrated with nitric acid to obtain 3-(5-Nitro-2-furyl)acrylic acid. |
| | 3-(5-Nitro-2-furyl)acrylic acid Preparation Products And Raw materials |
|