|
|
| | 2-METHYLIMIDAZOLE-D6 Basic information |
| Product Name: | 2-METHYLIMIDAZOLE-D6 | | Synonyms: | 2-METHYLIMIDAZOLE-D6;2-METHYLIMIDAZOLE (D6, 98%);Ondansetron Impurity 6-d6(Ondansetron EP Impurity F-d6);Nicotinamide Impurity 261;2-Methylimidazole-d6;2-Methylimidazole (D?, 98%) | | CAS: | 1173022-19-9 | | MF: | C4D6N2 | | MW: | 88.14 | | EINECS: | | | Product Categories: | | | Mol File: | Mol File |  |
| | 2-METHYLIMIDAZOLE-D6 Chemical Properties |
| Melting point | 139 - 140°C | | Boiling point | 198°C (lit.) | | density | 1.104 g/mL at 25 °C | | storage temp. | Refrigerator | | solubility | DMSO (Slightly), Methanol (Slightly) | | form | Solid | | color | White to Off-White | | InChI | 1S/C4H6N2/c1-4-5-2-3-6-4/h2-3H,1H3,(H,5,6)/i1D3,2D,3D/hD | | InChIKey | LXBGSDVWAMZHDD-RSRPWSGMSA-N | | SMILES | [2H]c1nc(n([2H])c1[2H])C([2H])([2H])[2H] |
| Hazard Codes | C | | Risk Statements | 22-34 | | Safety Statements | 26-36/37/39-45 | | WGK Germany | WGK 2 | | Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 4 Oral Carc. 2 Eye Dam. 1 Repr. 1B Skin Corr. 1C |
| | 2-METHYLIMIDAZOLE-D6 Usage And Synthesis |
| Uses | 2-Methylimidazole-d6 (CAS# 1173022-19-9) is a useful isotopically labeled research compound. |
| | 2-METHYLIMIDAZOLE-D6 Preparation Products And Raw materials |
|