|
|
| | 2-(3,4-Dihydroxyphenyl)ethyl-1,1,2,2-d4-amine HCl Basic information |
| Product Name: | 2-(3,4-Dihydroxyphenyl)ethyl-1,1,2,2-d4-amine HCl | | Synonyms: | Dopamine-1,1,2,2-D4HCl;2-(3,4-Dihydroxyphenyl)ethyl-1,1,2,2-d4-amine Hydrochloride;ASL-279-d4;Cardiosteril-d4;Dopastat-d4;Dynatra-d4;Inotropin-d4;Inovan-d4 | | CAS: | 203633-19-6 | | MF: | C8H7D4NO2.ClH | | MW: | 193.66 | | EINECS: | | | Product Categories: | Isotope Labelled Compounds;Amines;Aromatics;Intermediates & Fine Chemicals;Pharmaceuticals | | Mol File: | 203633-19-6.mol |  |
| | 2-(3,4-Dihydroxyphenyl)ethyl-1,1,2,2-d4-amine HCl Chemical Properties |
| Melting point | 2410C(dec) | | Fp | 11℃ | | storage temp. | -20°C | | solubility | DMF: 30 mg/ml,DMSO: 30 mg/ml,Ethanol: 1 mg/ml,PBS (pH 7.2): 5 mg/ml | | form | Solid | | color | White to off-white | | Major Application | forensics and toxicology
pharmaceutical
veterinary | | InChI | InChI=1S/C8H11NO2.ClH/c9-4-3-6-1-2-7(10)8(11)5-6;/h1-2,5,10-11H,3-4,9H2;1H/i3D2,4D2; | | InChIKey | CTENFNNZBMHDDG-URZLSVTISA-N | | SMILES | C1(C([2H])([2H])C([2H])([2H])N)=CC=C(O)C(O)=C1.Cl | | CAS Number Unlabeled | 62-31-7 |
| | 2-(3,4-Dihydroxyphenyl)ethyl-1,1,2,2-d4-amine HCl Usage And Synthesis |
| Chemical Properties | Brown Solid | | Uses | Endogenous catecholamine with a and -adrenergic activity. Cardiotonic; antihypotensive. | | Uses | Labelled Dopamine. Endogenous catecholamine with α and β-adrenergic activity. Cardiotonic; antihypotensive. | | General Description | A stable labeled internal standard suitable for the quantitation of dopamine levels in LC/MS applications such as diagnostic testing, endocrinology, and clinical chemistry. Dopamine is a catecholamine which acts as a neurotransmitter for dopamine receptors and neurohormone for regulation of numerous brain functions. |
| | 2-(3,4-Dihydroxyphenyl)ethyl-1,1,2,2-d4-amine HCl Preparation Products And Raw materials |
|