| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
- TRA 100mg/ml
-
- $10.00
-
2026-09-15
- CAS:120-54-7
- Min. Order: 1box
- Purity: 99.99%
- Supply Ability: 9999
|
| | Bis(pentamethylene)thiuram tetrasulfide Basic information |
| | Bis(pentamethylene)thiuram tetrasulfide Chemical Properties |
| Melting point | 118.0 to 122.0 °C | | Boiling point | 510.1±33.0 °C(Predicted) | | density | 1.4933 (rough estimate) | | refractive index | 1.5700 (estimate) | | storage temp. | Sealed in dry,Room Temperature | | Water Solubility | Practically insoluble in water | | form | powder to crystal | | pka | 0.85±0.20(Predicted) | | color | White to Light yellow | | InChI | 1S/C12H20N2S6/c15-11(13-7-3-1-4-8-13)17-19-20-18-12(16)14-9-5-2-6-10-14/h1-10H2 | | InChIKey | VNDRMZTXEFFQDR-UHFFFAOYSA-N | | SMILES | S=C(SSSSC(=S)N1CCCCC1)N2CCCCC2 | | CAS DataBase Reference | 120-54-7(CAS DataBase Reference) | | EPA Substance Registry System | Dipentamethylenethiuram tetrasulfide (120-54-7) |
| Hazard Codes | N | | Risk Statements | 20/21/22-51/53 | | Safety Statements | 26-36/37/39-61 | | RIDADR | UN 3077 9 / PGIII | | WGK Germany | 2 | | RTECS | TN4221000 | | TSCA | TSCA listed | | HS Code | 2930.30.6000 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Aquatic Chronic 2 | | Toxicity | mouse,LD50,intraperitoneal,200mg/kg (200mg/kg),National Technical Information Service. Vol. AD277-689, |
| | Bis(pentamethylene)thiuram tetrasulfide Usage And Synthesis |
| Uses | Tetrasulfanediylbis(piperidin-1-ylmethanethione) is a thiuram type accelerators used in the self-healing, reshaping, and recycling of vulcanized rubber | | Contact allergens | Dipentamethylenethiuram tetrasulfide is a thiuram compound used as an accelerator for rubber vulcanization |
| | Bis(pentamethylene)thiuram tetrasulfide Preparation Products And Raw materials |
|