|
|
| | 3-Amino-3-(4-isopropylphenyl)propanoic acid Basic information |
| Product Name: | 3-Amino-3-(4-isopropylphenyl)propanoic acid | | Synonyms: | RARECHEM AL BL 0110;3-AMINO-3-(4-ISOPROPYL-PHENYL)-PROPIONIC ACID;3-(4-Isopropylphenyl)-beta-alanine;3-aMino-3-[4-(propan-2-yl)phenyl]propanoic acid;3-Amino-3-(4-isopropylphenyl);Benzenepropanoic acid, β-amino-4-(1-methylethyl)-;(R)-3-(1-aminopropyl)-5-methylbenzonitrile;3-Amino-3-(4-isopropylphenyl)propanoic acid | | CAS: | 117391-53-4 | | MF: | C12H17NO2 | | MW: | 207.27 | | EINECS: | | | Product Categories: | | | Mol File: | 117391-53-4.mol |  |
| | 3-Amino-3-(4-isopropylphenyl)propanoic acid Chemical Properties |
| Boiling point | 243°C | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | form | solid | | InChI | 1S/C12H17NO2/c1-8(2)9-3-5-10(6-4-9)11(13)7-12(14)15/h3-6,8,11H,7,13H2,1-2H3,(H,14,15) | | InChIKey | XRDCVKSGZNDEDT-UHFFFAOYSA-N | | SMILES | NC(CC(O)=O)C(C=C1)=CC=C1C(C)C |
| Hazard Codes | Xi,Xn | | Risk Statements | 22 | | WGK Germany | WGK 3 | | HazardClass | IRRITANT | | HS Code | 2922498590 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | 3-Amino-3-(4-isopropylphenyl)propanoic acid Usage And Synthesis |
| | 3-Amino-3-(4-isopropylphenyl)propanoic acid Preparation Products And Raw materials |
|