| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
5-Chloro-3-methyl-1-phenyl-1H-pyrazole-4-carbaldehyde manufacturers
|
| | 5-Chloro-3-methyl-1-phenyl-1H-pyrazole-4-carbaldehyde Basic information |
| | 5-Chloro-3-methyl-1-phenyl-1H-pyrazole-4-carbaldehyde Chemical Properties |
| Melting point | 145-148 °C (lit.) | | Boiling point | 356.1±37.0 °C(Predicted) | | density | 1.26 | | refractive index | 1.6000 (estimate) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | pka | -3.81±0.10(Predicted) | | form | powder to crystal | | color | White to Light yellow | | InChI | InChI=1S/C11H9ClN2O/c1-8-10(7-15)11(12)14(13-8)9-5-3-2-4-6-9/h2-7H,1H3 | | InChIKey | DKZPJLZXLKAMDO-UHFFFAOYSA-N | | SMILES | N1(C2=CC=CC=C2)C(Cl)=C(C=O)C(C)=N1 | | CAS DataBase Reference | 947-95-5(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 29331990 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 5-Chloro-3-methyl-1-phenyl-1H-pyrazole-4-carbaldehyde Usage And Synthesis |
| Chemical Properties | light yellow to yellow flakes or needles | | Uses | 5-Chloro-3-methyl-1-phenyl-4-pyrazolecarboxaldehyde (5-Chloro-3-methyl-1-phenyl-1H-pyrazole-4-carboxaldehyde) may be employed as starting material for the following syntheses:
- 5-chloro-3-methyl-1-phenyl-1H-pyrazole-4-carboxaldehyde hydrazone
- N1-((5-chloro-3-methyl-1-phenyl-1H-pyrazol-4-yl)methylene)thiosemicarbazone
- pyrazole derivatives, which were pharmacologically evaluated for analgesic (tail flick) and anti-inflammatory (based on carrageenan-induced paw edema) activities
- N′-[(5-chloro-3-methyl-1-phenyl-1H-pyrazol-4- yl)methylene] 2/4-substituted hydrazides
| | General Description | 5-Chloro-3-methyl-1-phenyl-4-pyrazolecarboxaldehyde (5-Chloro-3-methyl-1-phenyl-1H-pyrazole-4-carboxaldehyde) can be synthesized from 3-methyl-1-phenyl-1Hpyrazol-5(4H)-one under Vilsmeier-Haack reaction conditions. Knoevenagel condensation of 5-chloro-3-methyl-1-phenyl-1H-pyrazole-4-carboxaldehyde with ethylcyanoacetate at 0°C has been reported to afford ethyl-2-cyano-3-(5-chloro-3-methyl-1-phenyl-1H-pyrazole-4-yl)propionate. It participates in the synthesis of 2-((5-phenoxy-3-methyl-1-phenyl-1H-pyrazol- 4-yl)methylene)hydrazinecarbothiomide derivatives with a potential anticonvulsant property. |
| | 5-Chloro-3-methyl-1-phenyl-1H-pyrazole-4-carbaldehyde Preparation Products And Raw materials |
|