| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
3-Amino-5,6-dimethyl-1,2,4-triazine manufacturers
|
| | 3-Amino-5,6-dimethyl-1,2,4-triazine Basic information |
| Product Name: | 3-Amino-5,6-dimethyl-1,2,4-triazine | | Synonyms: | LABOTEST-BB LT00080728;OTAVA-BB BB7020204768;3-amino-5,6-dimethyl-as-triazin;3-amino-5,6-dimethyl-as-triazine;5,6-dimethyl-1,2,4-triazin-3-ylamine;5,6-Dimethyl-3-amino-1,2,4-triazine;3-Amino-5,6-dimethyl-1,2,4-triazine,97%;5,6-Dimethyl-1,2,4-triazin-3-amine | | CAS: | 17584-12-2 | | MF: | C5H8N4 | | MW: | 124.14 | | EINECS: | 241-552-4 | | Product Categories: | Miscellaneous;Building Blocks;Heterocyclic Building Blocks;Triazines | | Mol File: | 17584-12-2.mol |  |
| | 3-Amino-5,6-dimethyl-1,2,4-triazine Chemical Properties |
| Melting point | 210-212 °C(lit.) | | Boiling point | 220.93°C (rough estimate) | | density | 1.1954 (rough estimate) | | refractive index | 1.7380 (estimate) | | storage temp. | 2-8°C, protect from light | | pka | 4.67±0.63(Predicted) | | form | powder | | Appearance | Light yellow to brown Solid | | BRN | 118790 | | InChI | InChI=1S/C5H8N4/c1-3-4(2)8-9-5(6)7-3/h1-2H3,(H2,6,7,9) | | InChIKey | UIKGLXJNZXSPGV-UHFFFAOYSA-N | | SMILES | N1C(C)=C(C)N=C(N)N=1 | | CAS DataBase Reference | 17584-12-2(CAS DataBase Reference) | | EPA Substance Registry System | 3-Amino-5,6-dimethyl-1,2,4-triazine (17584-12-2) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-37/39 | | WGK Germany | 3 | | RTECS | XY3177100 | | HazardClass | IRRITANT | | HS Code | 29336990 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 3-Amino-5,6-dimethyl-1,2,4-triazine Usage And Synthesis |
| Chemical Properties | PINK TO YELLOW-BEIGE CRYSTALLINE POWDER | | Uses | 3-Amino-5,6-dimethyl-1,2,4-triazine was used in intramolecular cyclization reaction of various 1,2-bis(amidinohydrazone)s. | | General Description | 3-Amino-5,6-dimethyl-1,2,4-triazine reacts with silver trifluoro-methane-sulfonate to yield tris(3-amino-5,6-dimethyl-1,2,4-triazine-κN)silver(I) trifluromethane-sulfonate-3-amino-5,6-dimethyl-1,2,4-triazine. It reacts with an excess of benzoyl chloride in the presence of triethylamine in refluxing chloroform to give 3-dibenzoylamino-5,6-dimethyl-1,2,4-triazine. |
| | 3-Amino-5,6-dimethyl-1,2,4-triazine Preparation Products And Raw materials |
|