| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
1,4-Piperazinedipropanesulfonic acid manufacturers
|
| | 1,4-Piperazinedipropanesulfonic acid Basic information |
| Product Name: | 1,4-Piperazinedipropanesulfonic acid | | Synonyms: | PIPERAZINE-N,N'-BIS(3-PROPANESULFONIC ACID);TIMTEC-BB SBB008974;piperazine-1,4-dipropanesulphonic acid;1,4-Piperazinedipropanesulfonicacid;1,4-Piperazine-N,N'-bis(propane-3-sulphonic acid);Pipps1,4-Piperazine-N,NBis(PropanesulfonicAcid);PIPERAZINE-N,N'-BIS(3-PROPANESULFONIC ACID)PIPERAZINE-N,N'-BIS(3-PROPANESULFONIC ACID)PIPERAZINE-N,N'-BIS(3-PROPANESULFONIC ACID)PIPERAZINE-N,N'-BIS(3-PROPANESULFONIC ACID);PIPPS - CAS 5625-56-9 - Calbiochem | | CAS: | 5625-56-9 | | MF: | C10H22N2O6S2 | | MW: | 330.42 | | EINECS: | 227-059-7 | | Product Categories: | | | Mol File: | 5625-56-9.mol |  |
| | 1,4-Piperazinedipropanesulfonic acid Chemical Properties |
| Melting point | >400 °C (decomp) | | density | 1.413±0.06 g/cm3(Predicted) | | storage temp. | +2C to +8C | | solubility | water: 1% || 0.25 M NaOH: 5% | | form | White solid | | pka | 1.10±0.50(Predicted) | | color | white | | Water Solubility | water: 1%
0.25 M NaOH: 5% | | InChI | 1S/C10H22N2O6S2/c13-19(14,15)9-1-3-11-5-7-12(8-6-11)4-2-10-20(16,17)18/h1-10H2,(H,13,14,15)(H,16,17,18) | | InChIKey | PDLPTSJWDUCMKS-UHFFFAOYSA-N | | SMILES | [S](=O)(=O)(O)CCCN1CCN(CC1)CCC[S](=O)(=O)O | | EPA Substance Registry System | 1,4-Piperazinedipropanesulfonic acid (5625-56-9) |
| WGK Germany | WGK 1 | | TSCA | TSCA listed | | HS Code | 29335995 | | Storage Class | 11 - Combustible Solids |
| | 1,4-Piperazinedipropanesulfonic acid Usage And Synthesis |
| Uses | PIPPS is a kind of buffer commonly used in biological and biochemical research to maintain the acidity and alkalinity (pH value) of solutions[1]. | | General Description | A non-metal complexing, zwitterionic buffer with mixed-mode dissociation constants of pKa1 = 3.73 and pKa2 = 7.96 (100 mM, 25°C) PIPPS has no interference at wavelengths longer than 240 nm. | | References | [1] He C, et al. Effects of good’s buffers and pH on the structural transformation of zero valent iron and the oxidative degradation of contaminants[J]. Environmental science & technology, 2018, 52(3): 1393-1403. DOI:10.1021/acs.est.7b04030 |
| | 1,4-Piperazinedipropanesulfonic acid Preparation Products And Raw materials |
|