|
|
| | 2,5-Dihydroxy-1,4-benzenediacetic acid Basic information |
| Product Name: | 2,5-Dihydroxy-1,4-benzenediacetic acid | | Synonyms: | 1,4-Benzenediaceticacid, 2,5-dihydroxy-;2-[4-(carboxylatomethyl)-2,5-dihydroxyphenyl]acetate;AKOS AUF2058;2-[4-(carboxymethyl)-2,5-dihydroxyphenyl]acetic acid;2,5-dihydroxy-p-benzenediacetic acid;2,5-DIHYDROXY-1,4-BENZENEDIACETIC ACID 99+%;p-Benzenediacetic acid, 2,5-dihydroxy-;2,5-Dihydroxy-p-benzoldiessigsure | | CAS: | 5488-16-4 | | MF: | C10H10O6 | | MW: | 226.18 | | EINECS: | 226-819-5 | | Product Categories: | C10;Carbonyl Compounds;Carboxylic Acids | | Mol File: | 5488-16-4.mol |  |
| | 2,5-Dihydroxy-1,4-benzenediacetic acid Chemical Properties |
| Melting point | 281-283 °C (dec.) (lit.) | | Boiling point | 327.79°C (rough estimate) | | density | 1.4225 (rough estimate) | | refractive index | 1.6000 (estimate) | | storage temp. | Sealed in dry,Room Temperature | | form | powder or crystals | | pka | 3.83±0.10(Predicted) | | Appearance | White to off-white Solid | | InChI | InChI=1S/C10H10O6/c11-7-1-5(3-9(13)14)8(12)2-6(7)4-10(15)16/h1-2,11-12H,3-4H2,(H,13,14)(H,15,16) | | InChIKey | MCLKERLHVBEZIW-UHFFFAOYSA-N | | SMILES | C1(CC(O)=O)=CC(O)=C(CC(O)=O)C=C1O | | CAS DataBase Reference | 5488-16-4 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-37/39 | | WGK Germany | 3 | | HS Code | 29182900 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 2,5-Dihydroxy-1,4-benzenediacetic acid Usage And Synthesis |
| Chemical Properties | light beige crystalline powder | | Uses | 2,5-DIHYDROXY-1,4-BENZENEDIACETIC ACID is used as a ligand in the synthesis of MOF materials. |
| | 2,5-Dihydroxy-1,4-benzenediacetic acid Preparation Products And Raw materials |
|