|
|
| | ISOCHROMAN-4-ONE Basic information |
| Product Name: | ISOCHROMAN-4-ONE | | Synonyms: | ISOCHROMAN-4-ONE;isochroman-4-one 1H-isochromen-4-ol;3,4-dihydro-1H-2-benzopyran-4-one;1H-isochromen-4-one;ISOCHROMAN-4-ONE, 96%min;1H-isochromen-4(3H)-one | | CAS: | 20924-56-5 | | MF: | C9H8O2 | | MW: | 148.16 | | EINECS: | | | Product Categories: | | | Mol File: | 20924-56-5.mol |  |
| | ISOCHROMAN-4-ONE Chemical Properties |
| Melting point | 48 °C | | Boiling point | 99 °C(Press: 14 Torr) | | density | 1.098 g/cm3(Temp: 25 °C) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | Appearance | Off-white to light yellow Solid | | InChI | InChI=1S/C9H8O2/c10-9-6-11-5-7-3-1-2-4-8(7)9/h1-4H,5-6H2 | | InChIKey | OYXTZAZUFUWSIR-UHFFFAOYSA-N | | SMILES | C1OCC2=CC=CC=C2C1=O | | CAS DataBase Reference | 20924-56-5 |
| | ISOCHROMAN-4-ONE Usage And Synthesis |
| Uses | Isochroman-4-one is used as a reactant in the preparation of isochromanone hybrids bearing benzyl pyridinium moiety as dual binding site AChE inhibitors. |
| | ISOCHROMAN-4-ONE Preparation Products And Raw materials |
|