|
|
| | dimethyl 1,2,4,5-tetrazine-3,6-dicarboxylate Basic information |
| Product Name: | dimethyl 1,2,4,5-tetrazine-3,6-dicarboxylate | | Synonyms: | dimethyl 1,2,4,5-tetrazine-3,6-dicarboxylate;Nsc174664;1,2,4,5-Tetrazine-3,6-dicarboxylic acid, diMethyl ester;3,6-dimethyl 1,2,4,5-tetrazine-3,6-dicarboxylate;1,2,4,5-Tetrazine-3,6-dicarboxylic acid, 3,6-dimethyl ester;3,6-Bis(methoxycarbonyl)-1,2,4,5-tetrazine;dimethyl 1,2,4,5-tetrazine-3,6-dicarboxyl;TETRAZINE DERIVATIVE 2166-14-5 | | CAS: | 2166-14-5 | | MF: | C6H6N4O4 | | MW: | 198.14 | | EINECS: | | | Product Categories: | | | Mol File: | 2166-14-5.mol |  |
| | dimethyl 1,2,4,5-tetrazine-3,6-dicarboxylate Chemical Properties |
| Melting point | 176 °C(Solv: acetic acid (64-19-7)) | | Boiling point | 358.9±25.0 °C(Predicted) | | density | 1.434±0.06 g/cm3(Predicted) | | storage temp. | -20°C | | solubility | sol dioxane, CH2Cl2, THF, C6H6; insol H2O. | | form | crystals | | pka | -3.68±0.10(Predicted) | | InChI | 1S/C6H6N4O4/c1-13-5(11)3-7-9-4(10-8-3)6(12)14-2/h1-2H3 | | InChIKey | QODPSGGFQFBWME-UHFFFAOYSA-N | | SMILES | O=C(C1=NN=C(C(OC)=O)N=N1)OC |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | dimethyl 1,2,4,5-tetrazine-3,6-dicarboxylate Usage And Synthesis |
| Application | Dimethyl 1,2,4,5-tetrazine-3,6-dicarboxylate is a reactive heteroaromatic azadiene with inverse electron demand that undergoes Diels-Alder reactions with a variety of dienophiles and isodieniphiles; it is used to prepare substituted 1,2-diazines, 1,2,4-triazines, pyrroles, pyridines, indolines, and related fused heterocycles. | | Uses | 3,6-Dimethyl 1,2,4,5-Tetrazine-3,6-dicarboxylate (CAS# 2166-14-5) can be used in the synthesis of N-substituted dibenzoazepine-pyridazine derivatives via Diels-Alder reaction of dibenzoazepines with tetrazines for their use as potential neurologically active drugs. | | storage | Dimethyl 1,2,4,5-tetrazine-3,6-dicarboxylate is a very reactive diene which is unstable to acid, base, H2O, or protic solvents and should be stored moisture-free and refrigerated. |
| | dimethyl 1,2,4,5-tetrazine-3,6-dicarboxylate Preparation Products And Raw materials |
|