| Company Name: |
Rhawn Reagent Gold |
| Tel: |
400-1332688 18019345275 |
| Email: |
amy@rhawn.cn |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 4-Nitrobenzoic acid potassium salt Basic information |
| Product Name: | 4-Nitrobenzoic acid potassium salt | | Synonyms: | Nitrobenzoicacidpotassiumsalt;4-NITROBENZOIC ACID POTASSIUM SALT 99+%;p-Nitrobenzoic acid potassium salt;Benzoic acid, 4-nitro-,potassium salt (1:1);4-NitrobenzoicAcidPotassiumSalt>;SKL514;POTASSIUM 4-NITROBENZOATE;4-Nitrobenzoic acid potassium salt | | CAS: | 15922-01-7 | | MF: | C7H5NO4.K | | MW: | 206.22 | | EINECS: | | | Product Categories: | | | Mol File: | 15922-01-7.mol |  |
| | 4-Nitrobenzoic acid potassium salt Chemical Properties |
| storage temp. | Store at room temperature, keep dry and cool | | form | powder to crystal | | color | White to Orange to Green | | InChI | InChI=1S/C7H5NO4.K/c9-7(10)5-1-3-6(4-2-5)8(11)12;/h1-4H,(H,9,10);/q;+1/p-1 | | InChIKey | MKBKSBKMELRIKB-UHFFFAOYSA-M | | SMILES | C1(C=CC([N+]([O-])=O)=CC=1)C([O-])=O.[K+] | | CAS DataBase Reference | 15922-01-7 |
| | 4-Nitrobenzoic acid potassium salt Usage And Synthesis |
| | 4-Nitrobenzoic acid potassium salt Preparation Products And Raw materials |
|