|
|
| | D-Erythrose 4-phosphate sodium salt Basic information |
| Product Name: | D-Erythrose 4-phosphate sodium salt | | Synonyms: | 4-PHOSPHO-D-ERYTHROSE SODIUM SALT;Butanal, 2,3-dihydroxy-4-(phosphonooxy)-, monosodium salt, (2R,3R)-;D-Erythrose 4-phosphate sodium salt,4-Phospho-D-erythrose sodium salt;sodium,[(2R,3R)-2,3-dihydroxy-4-oxobutyl] hydrogen phosphate;Erythritol Impurity 6;sodium D-erythrose 4-phosphate;Paliperidone Impurity 50;D-ERYTHROSE 4-PHOSPHATE SODIUM | | CAS: | 103302-15-4 | | MF: | C4H10NaO7P | | MW: | 224.08 | | EINECS: | | | Product Categories: | | | Mol File: | 103302-15-4.mol |  |
| | D-Erythrose 4-phosphate sodium salt Chemical Properties |
| storage temp. | −20°C | | solubility | water: 50 mg/mL, clear to slightly hazy, colorless to faintly yellow | | form | Solid | | color | Colorless to off-white | | InChI | 1S/C4H9O7P.Na/c5-1-3(6)4(7)2-11-12(8,9)10;/h1,3-4,6-7H,2H2,(H2,8,9,10);/q;+1/p-1/t3-,4+;/m0./s1 | | InChIKey | KKDBADMPNGAKHM-RFKZQXLXSA-M | | SMILES | [Na+].[H]C(=O)[C@H](O)[C@H](O)COP(O)([O-])=O |
| WGK Germany | 3 | | F | 3-10 | | Storage Class | 11 - Combustible Solids |
| | D-Erythrose 4-phosphate sodium salt Usage And Synthesis |
| Uses | D-Erythrose 4-phosphate sodium is a phosphate sodium of the simple sugar Erythrose. Erythritol is actually converted into D-Erythrose 4-phosphate that involves three isomerases[1]. | | IC 50 | Human Endogenous Metabolite | | References | [1] Barbier T, et al. Erythritol feeds the pentose phosphate pathway via three new isomerases leading to D-erythrose-4-phosphate in Brucella. Proc Natl Acad Sci U S A. 2014 Dec 16;111(50):17815-20. DOI:10.1073/pnas.1414622111 |
| | D-Erythrose 4-phosphate sodium salt Preparation Products And Raw materials |
|