|
|
| | 2,2-Bis(4-aminophenyl)hexafluoropropane Basic information |
| Product Name: | 2,2-Bis(4-aminophenyl)hexafluoropropane | | Synonyms: | 6F-DIAMINE;2,2-Bis(4-aminophenyl)-1,1,1,3,3,3-hexafluoropropane;4,4'-(1,1,1,3,3,3-Hexafluoropropane-2,2-diyl)bisaniline;4,4'-(1,1,1,3,3,3-Hexafluoropropane-2,2-diyl)dianiline;4,4'-(1-Trifluoromethyl-2,2,2-trifluoroethylidene)bisaniline;4,4'-(Hexafluoroisopropylidene)bis(benzenamine);4,4'-(Hexafluoroisopropylidene)dianiline,98%;2,2-Bis(4-aminophenyl)hexafluoropropane 98% | | CAS: | 1095-78-9 | | MF: | C15H12F6N2 | | MW: | 334.26 | | EINECS: | 206-141-6 | | Product Categories: | Bisphenol AF type Compounds (for High-Performance Polymer Research);Functional Materials;Reagent for High-Performance Polymer Research;Amine Monomers;Monomers;Primary Amines;monomer;1095-78-9 | | Mol File: | 1095-78-9.mol |  |
| | 2,2-Bis(4-aminophenyl)hexafluoropropane Chemical Properties |
| Melting point | 195-198 °C(lit.) | | Boiling point | 351.2±42.0 °C(Predicted) | | density | 1.3410 (estimate) | | storage temp. | 2-8°C, protect from light | | solubility | Soluble in Methanol | | form | Crystalline Powder | | pka | 3.98±0.25(Predicted) | | color | White to light yellow | | Water Solubility | insoluble | | Sensitive | Air Sensitive | | InChI | InChI=1S/C15H12F6N2/c16-14(17,18)13(15(19,20)21,9-1-5-11(22)6-2-9)10-3-7-12(23)8-4-10/h1-8H,22-23H2 | | InChIKey | BEKFRNOZJSYWKZ-UHFFFAOYSA-N | | SMILES | C(C1=CC=C(N)C=C1)(C1=CC=C(N)C=C1)(C(F)(F)F)C(F)(F)F | | CAS DataBase Reference | 1095-78-9(CAS DataBase Reference) | | EPA Substance Registry System | Benzenamine, 4,4'-[2,2,2-trifluoro-1-(trifluoromethyl)ethylidene]bis- (1095-78-9) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-37/39 | | WGK Germany | 3 | | Hazard Note | Irritant | | TSCA | TSCA listed | | HS Code | 29215900 | | Storage Class | 11 - Combustible Solids |
| | 2,2-Bis(4-aminophenyl)hexafluoropropane Usage And Synthesis |
| Description | 2,2-Bis(4-aminophenyl)hexafluoropropane is a fluorinated organic monomer compound used in the synthesis of a wide variety of polymers and their derivatives, such as polyimides and polyamides. Polyhydroxylamides are used as carriers for thin film composite membranes for water treatment. | | Chemical Properties | white crystalline powder | | Uses | 2,2-Bis(4-aminophenyl)hexafluoropropane is used as a reactant in the crosslinking and stabilization of nanoparticle-filled polymethylpentyne nanocomposite membranes for gas separations. |
| | 2,2-Bis(4-aminophenyl)hexafluoropropane Preparation Products And Raw materials |
|