| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | 2-(1-Pentynyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane Basic information |
| Product Name: | 2-(1-Pentynyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane | | Synonyms: | 1-Pentynylboronic acid pinacol ester;2-(1-Pentynyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane;4,4,5,5-tetraMethyl-2-(pent-1-yn-1-yl)-1,3,2-dioxaborolane;1,3,2-Dioxaborolane, 4,4,5,5-tetramethyl-2-(1-pentyn-1-yl)-;1-Pentynylboronic acid pinacol ester 90%;1-Pentyne-1-boronic Acid Pinacol Ester | | CAS: | 634196-62-6 | | MF: | C11H19BO2 | | MW: | 194.08 | | EINECS: | | | Product Categories: | Alkynyl Boronate Esters;Boronate Esters;Boronic Acids and Derivatives;Chemical Synthesis;Organometallic Reagents | | Mol File: | 634196-62-6.mol |  |
| | 2-(1-Pentynyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane Chemical Properties |
| Boiling point | 68-72 °C/0.09 mmHg | | density | 0.9057 g/mL at 25 °C | | refractive index | n20/D 1.4479 | | Fp | 68 °C | | form | liquid | | InChI | 1S/C11H19BO2/c1-6-7-8-9-12-13-10(2,3)11(4,5)14-12/h6-7H2,1-5H3 | | InChIKey | RXNSNUUTGWELNS-UHFFFAOYSA-N | | SMILES | CCCC#CB1OC(C)(C)C(C)(C)O1 |
| RIDADR | NA 1993 / PGIII | | WGK Germany | 3 | | Storage Class | 10 - Combustible liquids |
| | 2-(1-Pentynyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane Usage And Synthesis |
| Uses | 1-Pentynylboronic acid pinacol ester can be used as:
- A substrate in the copper-catalyzed decyanative cross-coupling reactions with aryl selenocyanate to yield unsymmetrically substituted selanes.
- A reactant in the palladium-catalyzed 1,2-aminoacylation, 1,2-amino-vinylation and -alkynylation reactions with various oxime esters.
|
| | 2-(1-Pentynyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane Preparation Products And Raw materials |
|