|
|
| | (S)-(-)-2-[Bis(3,5-dimethylphenyl)hydroxymethyl]pyrrolidine Basic information |
| Product Name: | (S)-(-)-2-[Bis(3,5-dimethylphenyl)hydroxymethyl]pyrrolidine | | Synonyms: | (S)-(-)-2-[Bis(3,5-dimethylphenyl)hydroxymethyl]pyrrolidine;(S)-α,α-Bis(3,5-dimethylphenyl)-2-pyrrolidinemethanol;(S)-α,α-Bis(3,5-diMethylphenyl)-2-pyrrolidineMethanol >=99% (HPLC);(S)-alpha,alpha-Bis(3,5-dimethylphenyl)-2-pyrrolidinemethanol >=99% (HPLC);(S)-α,α-Bis(3,5-dimethylphenyl)-2-pyrrolidinemethanol,99%e.e.;(S)-Bis(3,5-dimethylphenyl)(pyrrolidin-2-yl)methanol;2-Pyrrolidinemethanol, α,α-bis(3,5-dimethylphenyl)-, (2S)-;(S)-alpha,alpha-Bis(3,5-dimethylphenyl)-2-pyrrolidinemethanol | | CAS: | 131180-63-7 | | MF: | C21H27NO | | MW: | 309.45 | | EINECS: | | | Product Categories: | | | Mol File: | 131180-63-7.mol | ![(S)-(-)-2-[Bis(3,5-dimethylphenyl)hydroxymethyl]pyrrolidine Structure](CAS/GIF/131180-63-7.gif) |
| | (S)-(-)-2-[Bis(3,5-dimethylphenyl)hydroxymethyl]pyrrolidine Chemical Properties |
| Melting point | 98-101 °C | | Boiling point | 488.2±35.0 °C(Predicted) | | density | 1.068±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | pka | 13.70±0.29(Predicted) | | Appearance | White to yellow Solid | | Optical Rotation | Consistent with structure | | InChI | InChI=1/C21H27NO/c1-14-8-15(2)11-18(10-14)21(23,20-6-5-7-22-20)19-12-16(3)9-17(4)13-19/h8-13,20,22-23H,5-7H2,1-4H3/t20-/s3 | | InChIKey | MXIOBZPVLNQGIU-FQEVSTJZSA-N | | SMILES | C1N[C@H](C(O)(C2C=C(C)C=C(C)C=2)C2C=C(C)C=C(C)C=2)CC1 |&1:2,r| |
| Hazard Codes | Xn,N | | Risk Statements | 22-50/53 | | Safety Statements | 60-61 | | RIDADR | UN 2811 6.1/PG 3 | | WGK Germany | 3 | | Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 4 Oral Aquatic Acute 1 |
| | (S)-(-)-2-[Bis(3,5-dimethylphenyl)hydroxymethyl]pyrrolidine Usage And Synthesis |
| Uses | (S)-α,α-Bis(3,5-dimethylphenyl)-2-pyrrolidinemethanol can be used as:
- A chiral organocatalyst in the preparation of α-[(phenyl)methyl]thio]alkanal derivatives using aldehydes as starting materials and [(phenyl)methyl]thio]triazole as a sulfur electrophile.
- A catalyst in the preparation of chiral bipyrazolidin-3-one derivatives by cycloadditions of azomethine imines with α,β-unsaturated aldehydes.
|
| | (S)-(-)-2-[Bis(3,5-dimethylphenyl)hydroxymethyl]pyrrolidine Preparation Products And Raw materials |
|