| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
2-(3-Cyanophenyl)-5,5μ-dimethyl-1,3,2-dioxaborinane manufacturers
|
| | 2-(3-Cyanophenyl)-5,5μ-dimethyl-1,3,2-dioxaborinane Basic information |
| Product Name: | 2-(3-Cyanophenyl)-5,5μ-dimethyl-1,3,2-dioxaborinane | | Synonyms: | (3-Cyanophenyl)boronic acid, neopentyl glycol ester;2-(3-Cyanophenyl)-5,5μ-dimethyl-1,3,2-dioxaborinane;(3-Cyanophenyl)boronic acid, neopentyl glycol ester 95%;3-Cyanophenylboronic acid neopentyl ester;3-(5,5-DiMethyl-1,3,2-dioxaborinan-2-yl)benzonitrile;Benzonitrile, 3-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)-;3-Cyanobenzeneboronic acid neopentyl glycol ester | | CAS: | 214360-45-9 | | MF: | C12H14BNO2 | | MW: | 215.06 | | EINECS: | | | Product Categories: | | | Mol File: | 214360-45-9.mol |  |
| | 2-(3-Cyanophenyl)-5,5μ-dimethyl-1,3,2-dioxaborinane Chemical Properties |
| Melting point | 85-87 °C | | Boiling point | 350.2±25.0 °C(Predicted) | | density | 1.08±0.1 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | form | solid | | Appearance | White to off-white Solid | | InChI | 1S/C12H14BNO2/c1-12(2)8-15-13(16-9-12)11-5-3-4-10(6-11)7-14/h3-6H,8-9H2,1-2H3 | | InChIKey | RTYUBKQTFNAFQC-UHFFFAOYSA-N | | SMILES | CC1(C)COB(OC1)c2cccc(c2)C#N |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | HS Code | 2931900090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 2-(3-Cyanophenyl)-5,5μ-dimethyl-1,3,2-dioxaborinane Usage And Synthesis |
| Uses | (3-Cyanophenyl)boronic acid, neopentyl glycol ester |
| | 2-(3-Cyanophenyl)-5,5μ-dimethyl-1,3,2-dioxaborinane Preparation Products And Raw materials |
|