| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Company Name: |
LaaJoo |
| Tel: |
021-60702684 18516024827 |
| Email: |
huang.jiayi@sinocompound.com |
|
| | (2S,1μS, 2μS)-Pyrrolidine-2-carboxylic acid (2-hydroxy-1,2-diphenyl-ethyl)amide Basic information |
| Product Name: | (2S,1μS, 2μS)-Pyrrolidine-2-carboxylic acid (2-hydroxy-1,2-diphenyl-ethyl)amide | | Synonyms: | (2S)-N-[(1S,2S)-2-Hydroxy-1,2-diphenylethyl]-2-pyrrolidinecarboxamide;(2S,1μS, 2μS)-Pyrrolidine-2-carboxylic acid (2-hydroxy-1,2-diphenyl-ethyl)amide;(2S)-N-[(1S,2S)-2-Hydroxy-1,2-diphenylethyl]-2-pyrrol;(2S)-N-[(1S,2S)-2-Hydroxy-1,2-diphenylethyl]-2-pyrrolidinecarboxaMide >=99% (HPLC);(2S)-N-[(1S,2S)-2-Hydroxy-1,2-diphenylethyl]-2-
pyrrolidinecarboxamide,99%e.e.;(2S)-N-[(1S,2S)-2-hydroxy-1,2-diphenylethyl]pyrrolidine-2-carboxamide;2-Pyrrolidinecarboxamide, N-[(1S,2S)-2-hydroxy-1,2-diphenylethyl]-, (2S)-;(S)-N-((1S,2S)-2-Hydroxy-1,2-diphenylethyl)pyrrolidine-2-carboxamide | | CAS: | 529486-26-8 | | MF: | C19H22N2O2 | | MW: | 310.39 | | EINECS: | | | Product Categories: | | | Mol File: | 529486-26-8.mol |  |
| | (2S,1μS, 2μS)-Pyrrolidine-2-carboxylic acid (2-hydroxy-1,2-diphenyl-ethyl)amide Chemical Properties |
| Melting point | 127-131 °C | | storage temp. | 2-8°C | | Optical Rotation | [α]/D -25±2°, c = 2 in ethanol | | InChI | 1S/C19H22N2O2/c22-18(15-10-5-2-6-11-15)17(14-8-3-1-4-9-14)21-19(23)16-12-7-13-20-16/h1-6,8-11,16-18,20,22H,7,12-13H2,(H,21,23)/t16-,17-,18-/m0/s1 | | InChIKey | JVOUIFUIIPEWLM-BZSNNMDCSA-N | | SMILES | O[C@H]([C@@H](NC(=O)[C@@H]1CCCN1)c2ccccc2)c3ccccc3 |
| Hazard Codes | T,N | | Risk Statements | 23/25-50 | | Safety Statements | 45-61 | | RIDADR | UN 2811 6.1/PG 3 | | WGK Germany | 3 | | Storage Class | 6.1C - Combustible acute toxic Cat.3
toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Inhalation
Acute Tox. 3 Oral
Aquatic Acute 1
Aquatic Chronic 1 |
| | (2S,1μS, 2μS)-Pyrrolidine-2-carboxylic acid (2-hydroxy-1,2-diphenyl-ethyl)amide Usage And Synthesis |
| Uses | (2S)-N-[(1S,2S)-2-Hydroxy-1,2-diphenylethyl]-2-pyrrolidinecarboxamide can be used as a catalyst:
- In the synthesis of α-hydroxyaminocarbonyl compounds by reactingaldehydeswithnitrosobenzenes via N-nitroso aldol reaction.
- In the direct aldol reactions of aldehydes with chloroacetones, methylthio- and fluoroacetones.
|
| | (2S,1μS, 2μS)-Pyrrolidine-2-carboxylic acid (2-hydroxy-1,2-diphenyl-ethyl)amide Preparation Products And Raw materials |
|