| Company Name: |
Energy Chemical
|
| Tel: |
021-021-58432009 400-005-6266 |
| Email: |
sales8178@energy-chemical.com |
| Products Intro: |
Product Name:2,3-DiMercapto-1-propanol tributyrate CAS:58428-97-0 Purity:97% Package:1G
|
| Company Name: |
Shanghai Hanhong Scientific Co.,Ltd.
|
| Tel: |
021-54306202 13764082696 |
| Email: |
info@hanhongsci.com |
| Products Intro: |
Product Name:2,3-Dimercapto-1-propanol tributyrate CAS:58428-97-0 Purity:98% Remarks:D78053
|
| Company Name: |
Wuxi Zhongkun Biochemical Technology Co., Ltd.
|
| Tel: |
0510-85629785 18013409632 |
| Email: |
sales@reading-chemicals.com |
| Products Intro: |
Product Name:2,3-Dimercapto-1-propanol tributyrate CAS:58428-97-0 Purity:98% Package:840/g
|
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Products Intro: |
Product Name:2,3-Dimercapto-1-propanol tributyrate CAS:58428-97-0 Purity:97% Package:1G Remarks:282413-1G
|
|
| | 2,3-DIMERCAPTO-1-PROPANOL TRIBUTYRATE Basic information |
| Product Name: | 2,3-DIMERCAPTO-1-PROPANOL TRIBUTYRATE | | Synonyms: | 2,3-DIMERCAPTO-1-PROPANOL TRIBUTYRATE;2,3-Dimercapto-1-propanol tributyrate 97%;BAL TRIBUTYRATE;2,3-DIMERCAPTO-1-PROPANOL TRIBUTYRATE, 9 7%;2,3-Bis(butanoylthio)propan-1-ol butanoate;3-Hydroxypropane-1,2-bisthiol tributanoate;BALB;Butyric acid 2,3-bis(butyrylthio)propyl ester | | CAS: | 58428-97-0 | | MF: | C15H26O4S2 | | MW: | 334.49 | | EINECS: | | | Product Categories: | | | Mol File: | 58428-97-0.mol |  |
| | 2,3-DIMERCAPTO-1-PROPANOL TRIBUTYRATE Chemical Properties |
| Boiling point | 156-160 °C0.15 mm Hg(lit.) | | density | 1.083 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.495(lit.) | | Fp | >230 °F | | form | liquid | | InChI | 1S/C15H26O4S2/c1-4-7-13(16)19-10-12(21-15(18)9-6-3)11-20-14(17)8-5-2/h12H,4-11H2,1-3H3 | | InChIKey | NHBKXEKEPDILRR-UHFFFAOYSA-N | | SMILES | CCCC(=O)OCC(CSC(=O)CCC)SC(=O)CCC |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | RIDADR | UN 2810 6.1/PG 3 | | WGK Germany | 3 | | HazardClass | 6.1(b) | | PackingGroup | III | | Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 2,3-DIMERCAPTO-1-PROPANOL TRIBUTYRATE Usage And Synthesis |
| Uses | 2,3-Dimercapto-1-propanol tributyrate is a thioester analog of triacylglycerol and has been used:
- in lipase inhibition assay during in vitro screening of medicinal plants as antidiabetics with glucosidase and lipase inhibitory activities
- in colorimetric microplate assay for lipase activity
- to analyze positional specificity of LipG (lipase-encoding gene) toward triacylglycerol by a simple continuous spectrophotometric method
|
| | 2,3-DIMERCAPTO-1-PROPANOL TRIBUTYRATE Preparation Products And Raw materials |
|