| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | Methyl-6-O-trityl-2,3,4-tri-O-benzyl-α-D-glucopyranoside Basic information |
| Product Name: | Methyl-6-O-trityl-2,3,4-tri-O-benzyl-α-D-glucopyranoside | | Synonyms: | Methyl 2,3,4-tri-O-benzyl-6-O-trityl-alpha-D-glucopyranoside;Methyl-6-O-trityl-2,3,4-tri-O-benzyl-α-D-glucopyranoside;Methyl 2,3,4-tri-O-benzyl-6-O-trityl-a-D-glucopyranoside;A-D-GLUCOPYRANOSIDE, METHYL2,3,4-TRIS-O-(PHENYLMETHYL)-6-O-(TRIPHENYLMETHYL)-;methyl 2,3,4-tri-O-benzyl-6-O-(triphenylmethyl)-α-Dglucopyranoside;α-D-Glucopyranoside, methyl 2,3,4-tris-O-(phenylmethyl)-6-O-(triphenylmethyl)-;Methyl 2,3,4-tri-O-benzyl-6-O-trityl-α-D-glucopyranoside | | CAS: | 18685-19-3 | | MF: | C47H46O6 | | MW: | 706.86 | | EINECS: | | | Product Categories: | Carbohydrates | | Mol File: | 18685-19-3.mol |  |
| | Methyl-6-O-trityl-2,3,4-tri-O-benzyl-α-D-glucopyranoside Chemical Properties |
| Melting point | >300 °C | | storage temp. | -20°C | | form | solid | | Optical Rotation | [α]22/D +14.0, c =0.5% in chloroform | | InChIKey | AYWIUINDNNLVIG-PSKPMRIASA-N | | SMILES | CO[C@@H]1[C@H](OCC2=CC=CC=C2)[C@@H](OCC3=CC=CC=C3)[C@H](OCC4=CC=CC=C4)[C@@H](COC(C5=CC=CC=C5)(C6=CC=CC=C6)C7=CC=CC=C7)O1 |
| WGK Germany | WGK 3 | | Storage Class | 13 - Non Combustible Solids |
| | Methyl-6-O-trityl-2,3,4-tri-O-benzyl-α-D-glucopyranoside Usage And Synthesis |
| | Methyl-6-O-trityl-2,3,4-tri-O-benzyl-α-D-glucopyranoside Preparation Products And Raw materials |
|