|
|
| | Phenyl-α-D-thio-mannopyranosid Basic information |
| Product Name: | Phenyl-α-D-thio-mannopyranosid | | Synonyms: | Phenyl-α-D-thio-mannopyranosid;α-D-Mannopyranoside, phenyl 1-thio-;Phenyl 1-thio-α-D-mannopyranoside;Phenyl α-D-thiomannopyranoside;A0705;Phenyl a-D-thiomannopyranoside;Phenyl alpha-D-thiomannopyranoside;Phenyl 1-thio-α-D-mannopyra- noside | | CAS: | 77481-62-0 | | MF: | C12H16O5S | | MW: | 272.32 | | EINECS: | | | Product Categories: | Carbohydrates | | Mol File: | 77481-62-0.mol |  |
| | Phenyl-α-D-thio-mannopyranosid Chemical Properties |
| Melting point | 126-131°C | | storage temp. | 2-8°C | | form | solid | | Optical Rotation | [α]22/D +254°, c = 0.5% in methanol | | InChI | 1S/C12H16O5S/c13-6-8-9(14)10(15)11(16)12(17-8)18-7-4-2-1-3-5-7/h1-5,8-16H,6H2/t8-,9-,10+,11+,12-/m1/s1 | | InChIKey | OVLYAISOYPJBLU-LDMBFOFVSA-N | | SMILES | O[C@@H]1[C@H](O)[C@@H](SC2=CC=CC=C2)O[C@H](CO)[C@H]1O |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | Phenyl-α-D-thio-mannopyranosid Usage And Synthesis |
| Uses | Phenyl 1-Thio-α-D-mannopyranoside is a reagent in the synthesis of phenyl 4,6-O-benzylidene-1-thio-α-D-mannopyranoside by using benzylidene acetal-directed β-mannosylation. |
| | Phenyl-α-D-thio-mannopyranosid Preparation Products And Raw materials |
|