|
|
| | 2,2-Dimethyl-6-acetyl-2H-1-benzopyran Basic information |
| Product Name: | 2,2-Dimethyl-6-acetyl-2H-1-benzopyran | | Synonyms: | 2,2-Dimethyl-6-acetyl-2H-1-benzopyran;6-Acetyl-2,2-dimethyl-2H-1-benzopyran;6-Acetyl-2,2-dimethyl-3-chromene;Demethoxyencecalin;Desmethoxyencecalin;Methyl(2,2-dimethyl-2H-1-benzopyran-6-yl) ketone;1-(2,2-Dimethyl-2H-chromen-6-yl)-ethanone;2,2-diMethyl-2H-chroMene | | CAS: | 19013-07-1 | | MF: | C13H14O2 | | MW: | 202.25 | | EINECS: | | | Product Categories: | | | Mol File: | 19013-07-1.mol |  |
| | 2,2-Dimethyl-6-acetyl-2H-1-benzopyran Chemical Properties |
| Boiling point | 329.8±42.0 °C(Predicted) | | density | 1.061±0.06 g/cm3(Predicted) | | storage temp. | Store at -20°C | | solubility | Soluble in DMSO | | form | Off-white to yellowish solid. | | color | Yellow to brown | | InChI | InChI=1S/C13H14O2/c1-9(14)10-4-5-12-11(8-10)6-7-13(2,3)15-12/h4-8H,1-3H3 | | InChIKey | ZAJTXVHECZCXLH-UHFFFAOYSA-N | | SMILES | C(=O)(C1C=C2C(=CC=1)OC(C)(C)C=C2)C |
| | 2,2-Dimethyl-6-acetyl-2H-1-benzopyran Usage And Synthesis |
| Uses | Demethoxyencecalin is a chromene isolated from Helianthus annuus, has antifungal activities[1]. | | Definition | ChEBI: 6-Acetyl-2,2-dimethyl-2H-1-benzopyran is a 1-benzopyran. | | Synthesis Reference(s) | Journal of Heterocyclic Chemistry, 32, p. 219, 1995 DOI: 10.1002/jhet.5570320136
Synthesis, p. 144, 1979 DOI: 10.1055/s-1979-28595 | | References | [1] Prats E, et al. Antifungal activity of a new phenolic compound from capitulum of a head rot-resistant sunflower genotype. J Chem Ecol.2007 Dec;33(12):2245-53. Epub 2007 Nov 22. DOI:10.1007/s10886-007-9388-9 |
| | 2,2-Dimethyl-6-acetyl-2H-1-benzopyran Preparation Products And Raw materials |
|