| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Company Name: |
NovoChemy Ltd. |
| Tel: |
86-(0)21-31261262 373522135 |
| Email: |
sales@novochemy.com |
|
| | 6-Amino-1-ethyl-3-propyluracil Basic information |
| Product Name: | 6-Amino-1-ethyl-3-propyluracil | | Synonyms: | 6-Amino-1-ethyl-3-propyluracil;Brn 0162762;Uracil, 6-amino-1-ethyl-3-propyl-;6-aMino-1-ethyl-3-propyl-1,2,3,4-
tetrahydropyriMidine-2,4-dione;6-AMino-1-ethyl-3-propyl-2,4(1H,3H)-pyriMidinedione;1-Ethyl-3-propyl-6-aminouracil;2,4(1H,3H)-Pyrimidinedione, 6-amino-1-ethyl-3-propyl- | | CAS: | 63981-31-7 | | MF: | C9H15N3O2 | | MW: | 197.23 | | EINECS: | | | Product Categories: | Amines, Nucleotides, Bases & Related Reagents, Pharmaceuticals, Intermediates & Fine Chemicals | | Mol File: | 63981-31-7.mol |  |
| | 6-Amino-1-ethyl-3-propyluracil Chemical Properties |
| storage temp. | Store at 0-8 °C | | form | solid | | Appearance | light yellow solid | | InChI | 1S/C9H15N3O2/c1-3-5-12-8(13)6-7(10)11(4-2)9(12)14/h6H,3-5,10H2,1-2H3 | | InChIKey | YPSQTTRYMSZAGR-UHFFFAOYSA-N | | SMILES | O=C(N1CCC)C=C(N)N(CC)C1=O |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | 6-Amino-1-ethyl-3-propyluracil Usage And Synthesis |
| Uses | 6-Amino-1-ethyl-3-propyluracil is an intermediate in the synthesis of a series of new substituted Xanthines which have high affinity and selectivity for the human adenosine A2B receptors, and thus can be used as clinical candidate for chronic inflammatory airway diseases. |
| | 6-Amino-1-ethyl-3-propyluracil Preparation Products And Raw materials |
| Raw materials | Methanimidamide, N'-(3-ethyl-1,2,3,6-tetrahydro-2,6-dioxo-1-propyl-4-pyrimidinyl)-N,N-dimethyl-, (1E)--->Methanimidamide, N'-(3-ethyl-1,2,3,6-tetrahydro-2,6-dioxo-1-propyl-4-pyrimidinyl)-N,N-dimethyl- |
|