|
|
| | 2,6-Dimethyl-4-nitrosophenol Basic information |
| Product Name: | 2,6-Dimethyl-4-nitrosophenol | | Synonyms: | 4-Methyl-6-cyclohexyl-2-pirone;6-CYCLOHEXYL-4-METHYL PYRAN-2-ONE;6-CYCLOHEXYL-4-METHYL-2-PYRONE;2,6-Dimethyl-4-nitrosophenol;Ciclopirox Related Compound B (25 mg) (6-Cyclohexyl-4-methyl-2-pyrone);Ciclopirox Related CoMpound B, USP;6-Cyclohexyl-4-Methyl-2H-pyran-2-one;Ciclopirox Related CoMpound B | | CAS: | 14818-35-0 | | MF: | C12H16O2 | | MW: | 192.25 | | EINECS: | 236-382-2 | | Product Categories: | Heterocycles;Intermediates | | Mol File: | 14818-35-0.mol |  |
| | 2,6-Dimethyl-4-nitrosophenol Chemical Properties |
| Melting point | >47°C (dec.) | | Boiling point | 332.2±11.0 °C(Predicted) | | density | 1.088±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | solubility | Chloroform (Slightly), DMSO (Slightly), Methanol (Slightly) | | form | Solid | | color | White to Off-White | | Stability: | Light Sensitive | | Major Application | pharmaceutical small molecule | | InChI | InChI=1S/C12H16O2/c1-9-7-11(14-12(13)8-9)10-5-3-2-4-6-10/h7-8,10H,2-6H2,1H3 | | InChIKey | GPKRKAFTZYODFF-UHFFFAOYSA-N | | SMILES | C1(=O)OC(C2CCCCC2)=CC(C)=C1 |
| WGK Germany | 3 | | HS Code | 2932206000 | | Storage Class | 11 - Combustible Solids |
| | 2,6-Dimethyl-4-nitrosophenol Usage And Synthesis |
| Uses | 6-Cyclohexyl-4-methyl-2H-pyran-2-one is a a dialkylated pyranone derivative. | | Uses | 6-Cyclohexyl-4-methyl-2H-pyran-2-one (Ciclopirox EP Impurity B) is a a dialkylated pyranone derivative. |
| | 2,6-Dimethyl-4-nitrosophenol Preparation Products And Raw materials |
|