4-Methoxybenzaldehyde-3-sulfonic acid sodium salt manufacturers
|
| | 4-Methoxybenzaldehyde-3-sulfonic acid sodium salt Basic information |
| Product Name: | 4-Methoxybenzaldehyde-3-sulfonic acid sodium salt | | Synonyms: | 4-METHOXYBENZALDEHYDE-3-SULFONIC ACID SODIUM SALT 96%;Sodium 5-formyl-2-methoxybenzenesulphonate 96%;5-FORMYL-2-METHOXYBENZENESULFONIC ACID SODIUM SALT;5-formyl-2-methoxy-benzenesulfonicacisodiumsalt;sodium 5-formyl-2-methoxybenzenesulphonate;4-Methoxybenzaldehyde-3-sulfonic acid sodiumsalt,96%;sodium 5-formyl-2-methoxybenzenesulfonic acid;Sodium 5-formyl-2-methoxybenzenesulfonate | | CAS: | 5393-59-9 | | MF: | C8H7NaO5S | | MW: | 238.19 | | EINECS: | 226-400-7 | | Product Categories: | | | Mol File: | 5393-59-9.mol |  |
| | 4-Methoxybenzaldehyde-3-sulfonic acid sodium salt Chemical Properties |
| InChI | InChI=1S/C8HF15O4/c9-2(10,1(24)25)26-7(20,21)8(22,23)27-6(18,19)4(13,14)3(11,12)5(15,16)17/h(H,24,25) | | InChIKey | MGJFLYWFXJHHSI-UHFFFAOYSA-M | | SMILES | [Na+].[S](=O)(=O)([O-])c1c(ccc(c1)C=O)OC | | CAS DataBase Reference | 5393-59-9 | | EPA Substance Registry System | Benzenesulfonic acid, 5-formyl-2-methoxy-, sodium salt (5393-59-9) |
| Safety Statements | 24/25 | | WGK Germany | WGK 3 | | TSCA | TSCA listed | | HS Code | 29130000 | | Storage Class | 11 - Combustible Solids |
| Provider | Language |
|
ACROS
| English |
| | 4-Methoxybenzaldehyde-3-sulfonic acid sodium salt Usage And Synthesis |
| Chemical Properties | white to light beige crystalline powder |
| | 4-Methoxybenzaldehyde-3-sulfonic acid sodium salt Preparation Products And Raw materials |
|