| Company Name: |
Alfa Chemistry |
| Tel: |
1-516-6625404 |
| Email: |
support@alfa-chemistry.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
marketing1@energy-chemical.com |
|
| | EOSIN-5-MALEIMIDE Basic information |
| Product Name: | EOSIN-5-MALEIMIDE | | Synonyms: | EOSIN-5-MALEIMIDE;1-(2',4',5',7'-tetrabromo-3',6'-dihydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-5-yl)pyrrole-2,5-dione;Eosin-5-MaleiMide [5-MaleiMido-eosin];1H-Pyrrole-2,5-dione, 1-(2',4',5',7'-tetrabromo-3',6'-dihydroxy-3-oxospiro[isobenzofuran-1(3H),9'-[9H]xanthen]-5-yl)-;5-Maleimido-eosin for fluorescence, >=93% (HPLC);5-Maleimidoeosin, Fluorescent triplet probe;5-Maleimido-eosin【63184】;5-MALEIMIDO-EOSIN | | CAS: | 150322-02-4 | | MF: | C24H9Br4NO7 | | MW: | 742.95 | | EINECS: | | | Product Categories: | | | Mol File: | 150322-02-4.mol |  |
| | EOSIN-5-MALEIMIDE Chemical Properties |
| Boiling point | 773.9±60.0 °C(Predicted) | | density | 2.50±0.1 g/cm3(Predicted) | | storage temp. | 2-8°C | | pka | 6.92±0.20(Predicted) | | form | powder | | color | light orange to dark orange || light red | | InChI | 1S/C24H9Br4NO7/c25-13-6-11-21(17(27)19(13)32)35-22-12(7-14(26)20(33)18(22)28)24(11)10-2-1-8(5-9(10)23(34)36-24)29-15(30)3-4-16(29)31/h1-7,32-33H | | InChIKey | YRCLWXRIEYQTAV-UHFFFAOYSA-N | | SMILES | Oc1c(Br)cc2c(Oc3c(Br)c(O)c(Br)cc3C24OC(=O)c5cc(ccc45)N6C(=O)C=CC6=O)c1Br |
| WGK Germany | 3 | | F | 8-21 | | Storage Class | 11 - Combustible Solids |
| | EOSIN-5-MALEIMIDE Usage And Synthesis |
| Description | 5-Maleimido-eosin is a thiol-reactive fluorescent probe that can be used as a phosphorescent probe or as photosensitizers. | | Uses | Eosin-5-maleimide has been used as a fluorescent probe for the human erythrocyte band 3 protein. It is widely used as a diagnostic probe for the laboratory detection of hereditary spherocytosis (HS) by flow cytometry. The eosin-5-maleimide binding test was done to analyze the effect of alectinib (first line of treatment) for anaplastic lymphoma kinase (ALK). |
| | EOSIN-5-MALEIMIDE Preparation Products And Raw materials |
|