| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | Coproporphyrin III tetramethyl ester Basic information |
| Product Name: | Coproporphyrin III tetramethyl ester | | Synonyms: | TETRAMETHYL 3,8,13,17-TETRAMETHYL-21H,23H-PORPHINE-2,7,12,18-TETRAPROPIONATE;23h-porphine-2,7,12,18-tetrapropanoicacid,3,8,13,17-tetramethyl-21tetrame;COPROPORPHYRIN-3 TETRAMETHYL ESTER;COPROPORPHYRIN III TETRAMETHYL ESTER, SY NTHETIC, 99%;COPROPORPHYRIN-3 TETRAMETHYL ESTER (PREWEIGHED);3,8,13,17-Tetramethyl-21H,23H-porphyrin-2,7,12,18-tetrapropanoic acid tetramethyl ester;3,8,13,17-Tetramethyl-21H,23H-porphyrin-2,7,12,18-tetrapropionic acid tetramethyl ester;3-[7,12,18-tris(3-keto-3-methoxy-propyl)-3,8,13,17-tetramethyl-21,24-dihydroporphin-2-yl]propionic acid methyl ester | | CAS: | 5522-63-4 | | MF: | C40H46N4O8 | | MW: | 710.82 | | EINECS: | 226-869-8 | | Product Categories: | Natural Porphyrins and Derivitives;Porphyrins | | Mol File: | 5522-63-4.mol |  |
| | Coproporphyrin III tetramethyl ester Chemical Properties |
| Melting point | 168-170 °C(lit.) | | Boiling point | 1058.9±65.0 °C(Predicted) | | density | 1.224±0.06 g/cm3(Predicted) | | storage temp. | -20°C | | solubility | Chloroform, Dichloromethane, Tetrahydrofuran | | form | Solid | | color | Purple | | biological source | synthetic (organic) | | InChIKey | LBHYIBKOOKXTGC-LHPWBCDESA-N | | SMILES | COC(=O)CCc1c(C)c2cc3[nH]c(cc4nc(cc5[nH]c(cc1n2)c(C)c5CCC(=O)OC)c(CCC(=O)OC)c4C)c(C)c3CCC(=O)OC | | EPA Substance Registry System | Coproporphyrin III tetramethyl ester (5522-63-4) |
| WGK Germany | 3 | | TSCA | TSCA listed | | Storage Class | 11 - Combustible Solids |
| | Coproporphyrin III tetramethyl ester Usage And Synthesis |
| Chemical Properties | Purple Solid | | Uses | Coproporphyrin III Tetramethyl Ester is a methyl ester derivative of Coproporphyrin III. Coproporphyrin I and III Tetramethyl Ester are nutritional requirements for the development of N. brasiliensis egg to third stage larvae. Coproporphyrin I and III Tetramethyl Ester are tetrapyrrole compounds excreted by Rhodobacter sphaeroides. | | General Description | One of the main tetrapyrrole compounds secreted by Rhodobacter sphaeroides in culture. |
| | Coproporphyrin III tetramethyl ester Preparation Products And Raw materials |
|