| Company Name: |
yxinchem |
| Tel: |
+86-0710-4323688 +86-18071785587 |
| Email: |
market@yxinchem.com |
|
| | 3-Ethylphenyl(methyl) ether Basic information |
| Product Name: | 3-Ethylphenyl(methyl) ether | | Synonyms: | 3-Ethylphenyl(methyl) ether;m-Ethylanisole;3-methoxy-1-ethylbenzene;Benzene, 1-ethyl-3-methoxy-;1-Ethyl-3-methoxybenzene;3-Ethylanisole | | CAS: | 10568-38-4 | | MF: | C9H12O | | MW: | 136.19 | | EINECS: | | | Product Categories: | | | Mol File: | 10568-38-4.mol |  |
| | 3-Ethylphenyl(methyl) ether Chemical Properties |
| Boiling point | 197°C (estimate) | | density | 0.9575 | | refractive index | 1.5102 | | InChI | InChI=1S/C9H12O/c1-3-8-5-4-6-9(7-8)10-2/h4-7H,3H2,1-2H3 | | InChIKey | DWLZULQNIPIABE-UHFFFAOYSA-N | | SMILES | C1(CC)=CC=CC(OC)=C1 | | LogP | 3.280 (est) | | CAS DataBase Reference | 10568-38-4 |
| | 3-Ethylphenyl(methyl) ether Usage And Synthesis |
| | 3-Ethylphenyl(methyl) ether Preparation Products And Raw materials |
|