|
|
| | Phenoxycarbonyl-L-valine Basic information |
| Product Name: | Phenoxycarbonyl-L-valine | | Synonyms: | L-Valine, N-(phenoxycarbonyl)-;EOS-60805;(S)-3-Methyl-2-((phenoxycarbonyl)amino)butanoic acid;(2S)-3-METHYL-2-(PHENOXYCARBONYL)AMINOBUTYRIC ACID;(2S)-3-methyl-2-(phenoxycarbonylamino)butanoic acid;Ritonavir Intermediate 12;N-Phenoxy Carbonyl-L-Valine (PCV);*Phloroglucinol Impurity 62 | | CAS: | 126147-70-4 | | MF: | C12H15NO4 | | MW: | 237.25 | | EINECS: | | | Product Categories: | Amino Acids & Derivatives | | Mol File: | 126147-70-4.mol |  |
| | Phenoxycarbonyl-L-valine Chemical Properties |
| Melting point | 71 °C | | Boiling point | 374.1±34.0 °C(Predicted) | | density | 1.202±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | soluble in Acetone, Chloroform, Dichloromethane, Methanol | | form | Oil | | pka | 3.84±0.10(Predicted) | | color | Colourless | | InChI | InChI=1S/C12H15NO4/c1-8(2)10(11(14)15)13-12(16)17-9-6-4-3-5-7-9/h3-8,10H,1-2H3,(H,13,16)(H,14,15)/t10-/m0/s1 | | InChIKey | HVJMEAOTIUMIBJ-JTQLQIEISA-N | | SMILES | C(O)(=O)[C@H](C(C)C)NC(OC1=CC=CC=C1)=O |
| | Phenoxycarbonyl-L-valine Usage And Synthesis |
| Chemical Properties | Colourless Thick-Oil | | Uses | N-Phenoxycarbonyl-L-valine (cas# 126147-70-4) is a compound useful in organic synthesis. |
| | Phenoxycarbonyl-L-valine Preparation Products And Raw materials |
|