|
|
| | t-Butyl 2-(trifluoromethyl)acrylate Basic information |
| Product Name: | t-Butyl 2-(trifluoromethyl)acrylate | | Synonyms: | TERT-BUTYL 2-(TRIFLUOROMETHYL)ACRYLATE;alpha-Trifluoromethylacrylic acid-tert-butylester;tert-Butyl2-(trifluoromethyl)acrylate98%;TFMA-B, tert-Butyl 2-(trifluoromethyl)prop-2-enoate;TERT-BUTYL 2-(TRIFLUOROMETHYL)PROP-2-ENOATE;2-Propenoic acid,2-(trifluoromethyl)-, 1,1-dimethylethyl ester;2-(Trifluoromethyl)acrylic acid tert-butyl ester;tert-Butyl 2-(trifluoromethyl)acrylate,97%,stabilized with 0.025% 4-hydroxyTEMPO | | CAS: | 105935-24-8 | | MF: | C8H11F3O2 | | MW: | 196.17 | | EINECS: | | | Product Categories: | monomer | | Mol File: | 105935-24-8.mol |  |
| | t-Butyl 2-(trifluoromethyl)acrylate Chemical Properties |
| Boiling point | 174℃ | | density | 1.118 | | Fp | 37℃ | | storage temp. | 2-8°C, stored under nitrogen | | form | liquid | | color | Light yellow | | InChI | InChI=1S/C8H11F3O2/c1-5(8(9,10)11)6(12)13-7(2,3)4/h1H2,2-4H3 | | InChIKey | RCSSZBOUAGQERK-UHFFFAOYSA-N | | SMILES | C(OC(C)(C)C)(=O)C(C(F)(F)F)=C |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36/37/39 | | HazardClass | IRRITANT | | HS Code | 2916120090 |
| | t-Butyl 2-(trifluoromethyl)acrylate Usage And Synthesis |
| | t-Butyl 2-(trifluoromethyl)acrylate Preparation Products And Raw materials |
|